Difference between revisions of "PHESYN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * inchi key: ** InChIKey=HMFHBZSHGG...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PHESYN PHESYN] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PHESYN PHESYN] ==
* smiles:
+
* taxonomic range:
** C(C1(C(C(C(O1)O)O)O))O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** α-D-ribofuranose
+
** L-phenylalanine biosynthesis I
* molecular weight:
+
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
** α D-ribose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RIBOKIN-RXN]]
+
'''3''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[CHORISMATEMUT-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
* [[RXN-14904]]
+
*** [[Tiso_gene_5940]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-esiliculosus]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_13892]]
 +
*** [[Tiso_gene_10680]]
 +
*** [[Tiso_gene_15680]]
 +
*** [[Tiso_gene_17809]]
 +
*** [[Tiso_gene_17718]]
 +
*** [[Tiso_gene_13538]]
 +
*** [[Tiso_gene_6815]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[PREPHENATEDEHYDRAT-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_6815]]
 +
*** [[Tiso_gene_5940]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PHESYN PHESYN]
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-2157}}
** [http://www.chemspider.com/Chemical-Structure.5575.html 5575]
+
{{#set: taxonomic range=TAX-4751}}
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506]
+
{{#set: common name=L-phenylalanine biosynthesis I}}
* HMDB : HMDB00283
+
{{#set: reaction found=3}}
{{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}}
+
{{#set: total reaction=3}}
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}}
+
{{#set: completion rate=100.0}}
{{#set: common name=α-D-ribofuranose}}
+
{{#set: molecular weight=150.131    }}
+
{{#set: common name=α D-ribose}}
+
{{#set: consumed by=RIBOKIN-RXN}}
+
{{#set: consumed or produced by=RXN-14904}}
+

Latest revision as of 19:05, 21 March 2018

Pathway PHESYN

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links