Difference between revisions of "CPD-377"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.5.1.52-RXN 3.5.1.52-RXN] == * direction: ** REVERSIBLE * common name: ** peptide-n4-(n-acetyl-bet...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-377 CPD-377] == * smiles: ** C(C(C(C(C(CO)O)O)O)=O)([O-])=O * common name: ** 2-keto-D-gluc...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-377 CPD-377] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(C(C(C(CO)O)O)O)=O)([O-])=O |
* common name: | * common name: | ||
− | ** | + | ** 2-keto-D-gluconate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=VBUYCZFBVCCYFD-JJYYJPOSSA-M |
+ | * molecular weight: | ||
+ | ** 193.133 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-dehydro-D-gluconate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[1.1.1.274-RXN]] | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06473 C06473] |
− | ** [http://www. | + | * CHEMSPIDER: |
− | + | ** [http://www.chemspider.com/Chemical-Structure.5256721.html 5256721] | |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16808 16808] |
− | {{#set: | + | * BIGG : 2dhglcn |
− | + | * BIGG : 2dhguln | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857381 6857381] |
− | {{#set: | + | {{#set: smiles=C(C(C(C(C(CO)O)O)O)=O)([O-])=O}} |
+ | {{#set: common name=2-keto-D-gluconate}} | ||
+ | {{#set: inchi key=InChIKey=VBUYCZFBVCCYFD-JJYYJPOSSA-M}} | ||
+ | {{#set: molecular weight=193.133 }} | ||
+ | {{#set: common name=2-dehydro-D-gluconate}} | ||
+ | {{#set: reversible reaction associated=1.1.1.274-RXN}} |
Latest revision as of 19:13, 21 March 2018
Contents
Metabolite CPD-377
- smiles:
- C(C(C(C(C(CO)O)O)O)=O)([O-])=O
- common name:
- 2-keto-D-gluconate
- inchi key:
- InChIKey=VBUYCZFBVCCYFD-JJYYJPOSSA-M
- molecular weight:
- 193.133
- Synonym(s):
- 2-dehydro-D-gluconate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(C(C(C(CO)O)O)O)=O)([O-])=O" cannot be used as a page name in this wiki.