Difference between revisions of "Tiso gene 8982"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O) * inchi k...") |
(Created page with "Category:Gene == Gene Tiso_gene_8982 == * Synonym(s): == Reactions associated == * Reaction: RXN-4210 ** Source: orthology-esiliculosus * Reaction: RXN-707 **...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8982 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-4210]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | + | * Reaction: [[RXN-707]] | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[RXN66-27]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN66-323]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY66-341]] | ||
+ | * [[PWY66-3]] | ||
+ | * [[PWY-2541]] | ||
+ | * [[PWY66-4]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-4210|RXN-707|RXN66-27|RXN66-323}} | |
− | + | {{#set: pathway associated=PWY66-341|PWY66-3|PWY-2541|PWY66-4}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:06, 21 March 2018
Gene Tiso_gene_8982
- Synonym(s):
Reactions associated
- Reaction: RXN-4210
- Source: orthology-esiliculosus
- Reaction: RXN-707
- Source: orthology-esiliculosus
- Reaction: RXN66-27
- Source: orthology-esiliculosus
- Reaction: RXN66-323
- Source: orthology-esiliculosus