Difference between revisions of "X5NT"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=X5NT X5NT] == * direction: ** LEFT-TO-RIGHT * common name: ** XMP-5'-nucleotidase * Synonym(s): ==...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=X5NT X5NT] ==
−
* smiles:
+
* direction:
−
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L
+
 
* common name:
 
* common name:
−
** gibberellin A12
+
** XMP-5'-nucleotidase
−
* molecular weight:
+
−
** 330.423   
+
 
* Synonym(s):
 
* Synonym(s):
−
** C20-GAs
 
−
** open lactone gibberrellin skeleton
 
−
** C20 skeleton
 
−
** C20-GA skeleton
 
−
** C20-gibberellin skeleton
 
−
** GA12
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN1F-162]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[XANTHOSINE-5-PHOSPHATE]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[XANTHOSINE]][c]
−
* [[RXN1F-161]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 XMP[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 phosphate[c] '''+''' 1.0 xanthosine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6988]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_9166]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104170014
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=XMP-5'-nucleotidase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244528 25244528]
+
{{#set: gene associated=Tiso_gene_6988|Tiso_gene_9166}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58627 58627]
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11857 C11857]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L}}
+
−
{{#set: common name=gibberellin A12}}
+
−
{{#set: molecular weight=330.423    }}
+
−
{{#set: common name=C20-GAs|open lactone gibberrellin skeleton|C20 skeleton|C20-GA skeleton|C20-gibberellin skeleton|GA12}}
+
−
{{#set: consumed by=RXN1F-162}}
+
−
{{#set: produced by=RXN1F-161}}
+

Latest revision as of 19:06, 21 March 2018

Reaction X5NT

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • XMP-5'-nucleotidase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=X5NT&oldid=39539"