Difference between revisions of "LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE] == * smiles: ** C(C5(OC(OC...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(C5(OC(OC1(C(C(C(C([O-])=O)OC1OC4(C=C3(C(C(C=C(C2(=CC=C(C(=C2)O)O))O3)=O)=C(C=4)O)))O)O))C(C(C5O)O)O))([O-])=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** luteolin 7-O-β-D-diglucuronide |
+ | * inchi key: | ||
+ | ** InChIKey=PBBVWJQPAZYQDB-DBFWEQBMSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 636.476 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-15288]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15289]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878427 46878427] |
− | * HMDB : | + | * HMDB : HMDB60297 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57815 57815] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=C( | + | ** [http://www.genome.jp/dbget-bin/www_bget?C12632 C12632] |
− | {{#set: | + | {{#set: smiles=C(C5(OC(OC1(C(C(C(C([O-])=O)OC1OC4(C=C3(C(C(C=C(C2(=CC=C(C(=C2)O)O))O3)=O)=C(C=4)O)))O)O))C(C(C5O)O)O))([O-])=O}} |
− | {{#set: | + | {{#set: common name=luteolin 7-O-β-D-diglucuronide}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=PBBVWJQPAZYQDB-DBFWEQBMSA-L}} |
− | {{#set: common name= | + | {{#set: molecular weight=636.476 }} |
− | {{#set: consumed by= | + | {{#set: common name=luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]}} |
− | {{#set: produced by= | + | {{#set: consumed by=RXN-15288}} |
+ | {{#set: produced by=RXN-15289}} |
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE
- smiles:
- C(C5(OC(OC1(C(C(C(C([O-])=O)OC1OC4(C=C3(C(C(C=C(C2(=CC=C(C(=C2)O)O))O3)=O)=C(C=4)O)))O)O))C(C(C5O)O)O))([O-])=O
- common name:
- luteolin 7-O-β-D-diglucuronide
- inchi key:
- InChIKey=PBBVWJQPAZYQDB-DBFWEQBMSA-L
- molecular weight:
- 636.476
- Synonym(s):
- luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C5(OC(OC1(C(C(C(C([O-])=O)OC1OC4(C=C3(C(C(C=C(C2(=CC=C(C(=C2)O)O))O3)=O)=C(C=4)O)))O)O))C(C(C5O)O)O))([O-])=O" cannot be used as a page name in this wiki.
"luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide" cannot be used as a page name in this wiki.