Difference between revisions of "CPD-12826"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6788 PWY-6788] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12826 CPD-12826] == * smiles: ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12826 CPD-12826] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3)) |
* common name: | * common name: | ||
− | ** | + | ** folate |
+ | * inchi key: | ||
+ | ** InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-L | ||
+ | * molecular weight: | ||
+ | ** 439.387 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** folic acid | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[3.4.17.11-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549092 1549092] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.1266060.html 1266060] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62501 62501] | ||
+ | * HMDB : HMDB00121 | ||
+ | {{#set: smiles=C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))}} | ||
+ | {{#set: common name=folate}} | ||
+ | {{#set: inchi key=InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-L}} | ||
+ | {{#set: molecular weight=439.387 }} | ||
+ | {{#set: common name=folic acid}} | ||
+ | {{#set: consumed by=3.4.17.11-RXN}} |
Latest revision as of 20:06, 21 March 2018
Contents
Metabolite CPD-12826
- smiles:
- C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))
- common name:
- folate
- inchi key:
- InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-L
- molecular weight:
- 439.387
- Synonym(s):
- folic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))" cannot be used as a page name in this wiki.