Difference between revisions of "TRPCAT-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-786 CPD-786] == * smiles: ** C(CCC=CC(C([O-])=O)=O)([O-])=O * inchi key: ** InChIKey=HYVSZV...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRPCAT-PWY TRPCAT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRPCAT-PWY TRPCAT-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** ( | + | ** L-tryptophan degradation I (via anthranilate) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** anthranilate pathway |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[ | + | * [[ARYLFORMAMIDASE-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_16921]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | * [[KYNURENINASE-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_10685]] | ||
| + | *** [[Tiso_gene_10684]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8665 RXN-8665] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=L-tryptophan degradation I (via anthranilate)}} | |
| − | + | {{#set: common name=anthranilate pathway}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=67.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:07, 21 March 2018
Pathway TRPCAT-PWY
- taxonomic range:
- common name:
- L-tryptophan degradation I (via anthranilate)
- Synonym(s):
- anthranilate pathway
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- ARYLFORMAMIDASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- KYNURENINASE-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
