Difference between revisions of "PWY-4381"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4381 PWY-4381] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4381 PWY-4381] ==
* smiles:
+
* taxonomic range:
** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
+
 
* common name:
 
* common name:
** delphinidin 3,5-di-O-β-D-glucoside
+
** fatty acid biosynthesis initiation I
* molecular weight:
+
** 626.524   
+
 
* Synonym(s):
 
* Synonym(s):
** delphinidin-3,5-diglucoside
+
** de novo fatty acid biosynthesis, initial reactions
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''3''' reactions in the full pathway
* [[RXN-8228]]
+
* [[2.3.1.180-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_15991]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_2812]]
 +
*** [[Tiso_gene_3800]]
 +
*** [[Tiso_gene_5029]]
 +
*** [[Tiso_gene_7965]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-esiliculosus]]
 +
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_19309]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_18460]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_13394]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201902 25201902]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-4381 PWY-4381]
* CHEBI:
+
* ARACYC:
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77838 77838]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-4381 PWY-4381]
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2759}}
** [http://www.genome.jp/dbget-bin/www_bget?C16312 C16312]
+
{{#set: taxonomic range=TAX-2}}
* HMDB : HMDB30693
+
{{#set: common name=fatty acid biosynthesis initiation I}}
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))}}
+
{{#set: common name=de novo fatty acid biosynthesis, initial reactions}}
{{#set: inchi key=InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N}}
+
{{#set: reaction found=3}}
{{#set: common name=delphinidin 3,5-di-O-β-D-glucoside}}
+
{{#set: total reaction=3}}
{{#set: molecular weight=626.524    }}
+
{{#set: completion rate=100.0}}
{{#set: common name=delphinidin-3,5-diglucoside}}
+
{{#set: produced by=RXN-8228}}
+

Latest revision as of 19:07, 21 March 2018

Pathway PWY-4381

  • taxonomic range:
  • common name:
    • fatty acid biosynthesis initiation I
  • Synonym(s):
    • de novo fatty acid biosynthesis, initial reactions

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links