Difference between revisions of "PWY-7356"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * smiles: ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] * inchi key: ** InChIKe...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356] ==
* smiles:
+
* taxonomic range:
** C(C([N+])C(=O)[O-])S(=O)(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
** InChIKey=XVOYSCVBGLVSOL-REOHCLBHSA-M
+
 
* common name:
 
* common name:
** L-cysteate
+
** thiamine salvage IV (yeast)
* molecular weight:
+
** 168.144   
+
 
* Synonym(s):
 
* Synonym(s):
** L-cysteic acid
+
** thiamin salvage IV (yeast)
** 3-sulfoalanine
+
** 2-amino-3-sulfopropionic acid
+
** (R)-cysteate
+
** 3-sulfo-L-alanine
+
** (2R)-2-amino-3-sulfopropanoic acid
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[PYRIMSYN3-RXN]]
* [[RXN-11737]]
+
** 4 associated gene(s):
 +
*** [[Tiso_gene_2159]]
 +
*** [[Tiso_gene_16224]]
 +
*** [[Tiso_gene_17192]]
 +
*** [[Tiso_gene_2160]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXNQT-4191]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_4497]]
 +
*** [[Tiso_gene_15256]]
 +
*** [[Tiso_gene_17625]]
 +
*** [[Tiso_gene_11838]]
 +
*** [[Tiso_gene_17610]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[THI-P-SYN-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_10320]]
 +
*** [[Tiso_gene_2159]]
 +
*** [[Tiso_gene_2160]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_16512]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[THIAZOLSYN3-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3173]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=OHMETPYRKIN-RXN OHMETPYRKIN-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=THIAMINASE-RXN THIAMINASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7140381 7140381]
+
{{#set: taxonomic range=TAX-4751}}
* HMDB : HMDB02757
+
{{#set: common name=thiamine salvage IV (yeast)}}
* LIGAND-CPD:
+
{{#set: common name=thiamin salvage IV (yeast)}}
** [http://www.genome.jp/dbget-bin/www_bget?C00506 C00506]
+
{{#set: reaction found=5}}
* CHEMSPIDER:
+
{{#set: total reaction=7}}
** [http://www.chemspider.com/Chemical-Structure.5482600.html 5482600]
+
{{#set: completion rate=71.0}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58090 58090]
+
* METABOLIGHTS : MTBLC58090
+
{{#set: smiles=C(C([N+])C(=O)[O-])S(=O)(=O)[O-]}}
+
{{#set: inchi key=InChIKey=XVOYSCVBGLVSOL-REOHCLBHSA-M}}
+
{{#set: common name=L-cysteate}}
+
{{#set: molecular weight=168.144    }}
+
{{#set: common name=L-cysteic acid|3-sulfoalanine|2-amino-3-sulfopropionic acid|(R)-cysteate|3-sulfo-L-alanine|(2R)-2-amino-3-sulfopropanoic acid}}
+
{{#set: consumed or produced by=RXN-11737}}
+

Latest revision as of 19:08, 21 March 2018

Pathway PWY-7356

  • taxonomic range:
  • common name:
    • thiamine salvage IV (yeast)
  • Synonym(s):
    • thiamin salvage IV (yeast)

Reaction(s) found

5 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links