Difference between revisions of "CPD1F-115"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12472 == * Synonym(s): == Reactions associated == * 3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN ** pantograph-creinhardtii * HBNOm...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-115 CPD1F-115] == * smiles: ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-115 CPD1F-115] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C | ||
+ | * common name: | ||
+ | ** δ-carotene | ||
+ | * inchi key: | ||
+ | ** InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N | ||
+ | * molecular weight: | ||
+ | ** 536.882 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** ε,ψ-carotene | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-8028]] |
− | + | * [[RXN1F-148]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN1F-147]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281230 5281230] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4444642.html 4444642] | ||
+ | * HMDB : HMDB36925 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27705 27705] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C08586 C08586] | ||
+ | {{#set: smiles=CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C}} | ||
+ | {{#set: common name=δ-carotene}} | ||
+ | {{#set: inchi key=InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N}} | ||
+ | {{#set: molecular weight=536.882 }} | ||
+ | {{#set: common name=ε,ψ-carotene}} | ||
+ | {{#set: consumed by=RXN-8028|RXN1F-148}} | ||
+ | {{#set: produced by=RXN1F-147}} |
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CPD1F-115
- smiles:
- CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C
- common name:
- δ-carotene
- inchi key:
- InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N
- molecular weight:
- 536.882
- Synonym(s):
- ε,ψ-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links