Difference between revisions of "Tiso gene 11351"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=PYMYPHUHKU...")
(Created page with "Category:Gene == Gene Tiso_gene_11351 == * right end position: ** 7185 * transcription direction: ** POSITIVE * left end position: ** 6041 * centisome position: ** 76.8379...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] ==
+
== Gene Tiso_gene_11351 ==
−
* smiles:
+
* right end position:
−
** [CH](=O)C(O)C(O)C(O)CO
+
** 7185
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** aldehydo-L-arabinose
+
** 6041
−
* molecular weight:
+
* centisome position:
−
** 150.131    
+
** 76.83796    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.1.1.64-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
−
* [[RXN-14102]]
+
*** Assignment: automated-name-match
−
* [[RXN-14808]]
+
* Reaction: [[CARBOXYLESTERASE-RXN]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RETINYL-PALMITATE-ESTERASE-RXN]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-10711]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-10767]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-12252]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-12575]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXNQT-4366]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6857]]
 +
* [[PWY-6303]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=7185}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460291 5460291]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=6041}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6182 6182]
+
{{#set: centisome position=76.83796   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3.1.1.64-RXN|CARBOXYLESTERASE-RXN|RETINYL-PALMITATE-ESTERASE-RXN|RXN-10711|RXN-10767|RXN-12252|RXN-12575|RXNQT-4366}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11476 C11476]
+
{{#set: pathway associated=PWY-6857|PWY-6303}}
−
{{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}}
+
−
{{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N}}
+
−
{{#set: common name=aldehydo-L-arabinose}}
+
−
{{#set: molecular weight=150.131   }}
+
−
{{#set: consumed or produced by=RXN-14102|RXN-14808}}
+

Latest revision as of 19:08, 21 March 2018

Gene Tiso_gene_11351

  • right end position:
    • 7185
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6041
  • centisome position:
    • 76.83796
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11351&oldid=39678"