Difference between revisions of "PWY-7343"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * inchi key: ** InChIKey...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7343 PWY-7343] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7343 PWY-7343] ==
* smiles:
+
* taxonomic range:
** C(CC([N+])C(=O)[O-])ONC(=[N+])N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* common name:
 
* common name:
** L-canavanine
+
** UDP-glucose biosynthesis
* molecular weight:
+
** 177.183   
+
 
* Synonym(s):
 
* Synonym(s):
** canavanine
+
** UDP-D-glucose biosynthesis
** 2-amino-4-(guanidinooxy)butyrate
+
** UDP-α-D-glucose biosynthesis
** 2-amino-4-(guanidinooxy)butyric acid
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''2''' reactions in the full pathway
* [[RXN-22]]
+
* [[GLUC1PURIDYLTRANS-RXN]]
== Reaction(s) of unknown directionality ==
+
** 14 associated gene(s):
 +
*** [[Tiso_gene_6459]]
 +
*** [[Tiso_gene_4816]]
 +
*** [[Tiso_gene_17531]]
 +
*** [[Tiso_gene_5879]]
 +
*** [[Tiso_gene_17566]]
 +
*** [[Tiso_gene_16930]]
 +
*** [[Tiso_gene_14796]]
 +
*** [[Tiso_gene_9110]]
 +
*** [[Tiso_gene_13477]]
 +
*** [[Tiso_gene_7440]]
 +
*** [[Tiso_gene_11401]]
 +
*** [[Tiso_gene_6457]]
 +
*** [[Tiso_gene_6458]]
 +
*** [[Tiso_gene_7102]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[PHOSPHOGLUCMUT-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_4816]]
 +
*** [[Tiso_gene_13477]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 543-38-4
+
* ECOCYC:
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7343 PWY-7343]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688185 36688185]
+
{{#set: taxonomic range=TAX-2759}}
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78902 78902]
+
{{#set: taxonomic range=TAX-2157}}
* LIGAND-CPD:
+
{{#set: common name=UDP-glucose biosynthesis}}
** [http://www.genome.jp/dbget-bin/www_bget?C00308 C00308]
+
{{#set: common name=UDP-D-glucose biosynthesis|UDP-α-D-glucose biosynthesis}}
* HMDB : HMDB02706
+
{{#set: reaction found=2}}
{{#set: smiles=C(CC([N+])C(=O)[O-])ONC(=[N+])N}}
+
{{#set: total reaction=2}}
{{#set: inchi key=InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O}}
+
{{#set: completion rate=100.0}}
{{#set: common name=L-canavanine}}
+
{{#set: molecular weight=177.183    }}
+
{{#set: common name=canavanine|2-amino-4-(guanidinooxy)butyrate|2-amino-4-(guanidinooxy)butyric acid}}
+
{{#set: produced by=RXN-22}}
+

Latest revision as of 19:08, 21 March 2018

Pathway PWY-7343

  • taxonomic range:
  • common name:
    • UDP-glucose biosynthesis
  • Synonym(s):
    • UDP-D-glucose biosynthesis
    • UDP-α-D-glucose biosynthesis

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links