Difference between revisions of "RXN1G-1435"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == * smiles: ** C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1435 RXN1G-1435] == * direction: ** LEFT-TO-RIGHT * common name: ** trehalose-phosphatase * e...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1435 RXN1G-1435] ==
−
* smiles:
+
* direction:
−
** C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=CIPFCGZLFXVXBG-CNWJWELYSA-F
+
 
* common name:
 
* common name:
−
** D-myo-inositol (1,3,4,5)-tetrakisphosphate
+
** trehalose-phosphatase
−
* molecular weight:
+
* ec number:
−
** 492.013   
+
** [http://enzyme.expasy.org/EC/3.1.3.12 EC-3.1.3.12]
 
* Synonym(s):
 
* Synonym(s):
−
** Ins(1,3,4,5)P4
 
−
** inositol (1,3,4,5)-tetrakisphosphate
 
−
** 1D-myo-inositol (1,3,4,5)-tetrakisphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8730]]
+
* With identifiers:
−
* [[3.1.3.62-RXN]]
+
** 1 [[CPD1G-768]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[CPD1G-1344]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[2.7.1.139-RXN]]
+
** 1 6-O-α-mycolyl-trehalose 6-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 α, α'-trehalose 6-α-mycolate[c]
−
* [[2.7.1.127-RXN]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10840]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14220]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01272 C01272]
+
{{#set: common name=trehalose-phosphatase}}
−
* CHEBI:
+
{{#set: ec number=EC-3.1.3.12}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57895 57895]
+
{{#set: gene associated=Tiso_gene_10840|Tiso_gene_14220}}
−
* METABOLIGHTS : MTBLC57895
+
{{#set: in pathway=PWYG-321}}
−
* PUBCHEM:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24742076 24742076]
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
* HMDB : HMDB01059
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: smiles=C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)}}
+
−
{{#set: inchi key=InChIKey=CIPFCGZLFXVXBG-CNWJWELYSA-F}}
+
−
{{#set: common name=D-myo-inositol (1,3,4,5)-tetrakisphosphate}}
+
−
{{#set: molecular weight=492.013    }}
+
−
{{#set: common name=Ins(1,3,4,5)P4|inositol (1,3,4,5)-tetrakisphosphate|1D-myo-inositol (1,3,4,5)-tetrakisphosphate}}
+
−
{{#set: consumed by=RXN-8730|3.1.3.62-RXN}}
+
−
{{#set: produced by=2.7.1.139-RXN|2.7.1.127-RXN}}
+

Latest revision as of 19:08, 21 March 2018

Reaction RXN1G-1435

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trehalose-phosphatase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 6-O-α-mycolyl-trehalose 6-phosphate[c] + 1 H2O[c] => 1 phosphate[c] + 1 α, α'-trehalose 6-α-mycolate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1G-1435&oldid=39692"