Difference between revisions of "PWY-4101"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O * inchi key: ** InChIKey=R...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4101 PWY-4101] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4101 PWY-4101] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-71275 TAX-71275] |
* common name: | * common name: | ||
− | ** | + | ** D-sorbitol degradation I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** sorbitol utilization |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''3''' reactions found over '''3''' reactions in the full pathway |
− | + | * [[FRUCTOKINASE-RXN]] | |
− | == Reaction(s) | + | ** 3 associated gene(s): |
+ | *** [[Tiso_gene_1303]] | ||
+ | *** [[Tiso_gene_17974]] | ||
+ | *** [[Tiso_gene_3107]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-14515]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-7644]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[Tiso_gene_5424]] | ||
+ | *** [[Tiso_gene_6562]] | ||
+ | *** [[Tiso_gene_18533]] | ||
+ | *** [[Tiso_gene_15088]] | ||
+ | *** [[Tiso_gene_6563]] | ||
+ | *** [[Tiso_gene_5425]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-71275}} | |
− | + | {{#set: common name=D-sorbitol degradation I}} | |
− | + | {{#set: common name=sorbitol utilization}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=3}} | |
− | {{#set: | + | {{#set: completion rate=100.0}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:08, 21 March 2018
Pathway PWY-4101
- taxonomic range:
- common name:
- D-sorbitol degradation I
- Synonym(s):
- sorbitol utilization
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- FRUCTOKINASE-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- RXN-14515
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-7644
- 6 associated gene(s):
- 2 reconstruction source(s) associated: