Difference between revisions of "RNA-Ligase-L-lysine-adenylate"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] == * smiles: ** C(C1(=CC=CC(=C1O)O))([O-])=O * inc...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RNA-Ligase-L-lysine-adenylate RNA-Ligase-L-lysine-adenylate] == * common name: ** a [DNA ligase...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RNA-Ligase-L-lysine-adenylate RNA-Ligase-L-lysine-adenylate] ==
−
* smiles:
+
−
** C(C1(=CC=CC(=C1O)O))([O-])=O
+
−
* inchi key:
+
−
** InChIKey=GLDQAMYCGOIJDV-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 2,3-dihydroxybenzoate
+
** a [DNA ligase]-N6-(5'-adenylyl)-L-lysine
−
* molecular weight:
+
−
** 153.114   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2,3-dihydroxybenzoic acid
+
** a 5'-adenosyl [RNA ligase]-Nε-phosphono-L-lysine
−
** 3-hydroxysalicylate
+
−
** catechol-3-carboxylate
+
−
** 2-pyrocatechuate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17926]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[DHBDEHYD-RXN]]
+
* [[RXN-17925]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 303-38-8
+
{{#set: common name=a [DNA ligase]-N6-(5'-adenylyl)-L-lysine}}
−
* PUBCHEM:
+
{{#set: common name=a 5'-adenosyl [RNA ligase]-Nε-phosphono-L-lysine}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54675818 54675818]
+
{{#set: consumed by=RXN-17926}}
−
* HMDB : HMDB00397
+
{{#set: produced by=RXN-17925}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00196 C00196]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5323089.html 5323089]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36654 36654]
+
−
* BIGG : 23dhb
+
−
{{#set: smiles=C(C1(=CC=CC(=C1O)O))([O-])=O}}
+
−
{{#set: inchi key=InChIKey=GLDQAMYCGOIJDV-UHFFFAOYSA-M}}
+
−
{{#set: common name=2,3-dihydroxybenzoate}}
+
−
{{#set: molecular weight=153.114    }}
+
−
{{#set: common name=2,3-dihydroxybenzoic acid|3-hydroxysalicylate|catechol-3-carboxylate|2-pyrocatechuate}}
+
−
{{#set: produced by=DHBDEHYD-RXN}}
+

Latest revision as of 19:08, 21 March 2018

Metabolite RNA-Ligase-L-lysine-adenylate

  • common name:
    • a [DNA ligase]-N6-(5'-adenylyl)-L-lysine
  • Synonym(s):
    • a 5'-adenosyl [RNA ligase]-Nε-phosphono-L-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [DNA ligase]-N6-(5'-adenylyl)-L-lysine" cannot be used as a page name in this wiki.
"a 5'-adenosyl [RNA ligase]-Nε-phosphono-L-lysine" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RNA-Ligase-L-lysine-adenylate&oldid=39708"