Difference between revisions of "L-GLYCERALDEHYDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=LEU-DEG2-PWY LEU-DEG2-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-275...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=LEU-DEG2-PWY LEU-DEG2-PWY] ==
* smiles:
+
* taxonomic range:
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
+
 
* common name:
 
* common name:
** ergosta-5,7,24(28)-trien-3β-ol
+
** L-leucine degradation I
* molecular weight:
+
** 396.655   
+
 
* Synonym(s):
 
* Synonym(s):
** 5,7,24(28)-ergostatrienol
 
** 5-dehydro episterol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-707]]
+
'''6''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[2KETO-4METHYL-PENTANOATE-DEHYDROG-RXN]]
* [[RXN3O-218]]
+
** 0 associated gene:
== Reaction(s) of unknown directionality ==
+
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_18403]]
 +
*** [[Tiso_gene_14984]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3769]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_14499]]
 +
*** [[Tiso_gene_5029]]
 +
*** [[Tiso_gene_10675]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[METHYLGLUTACONYL-COA-HYDRATASE-RXN]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN0-2301]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_18542]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2759}}
** [http://www.genome.jp/dbget-bin/www_bget?C15780 C15780]
+
{{#set: taxonomic range=TAX-2}}
* HMDB : HMDB06848
+
{{#set: common name=L-leucine degradation I}}
* CHEBI:
+
{{#set: reaction found=6}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52972 52972]
+
{{#set: total reaction=6}}
* PUBCHEM:
+
{{#set: completion rate=100.0}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10894570 10894570]
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N}}
+
{{#set: common name=ergosta-5,7,24(28)-trien-3β-ol}}
+
{{#set: molecular weight=396.655    }}
+
{{#set: common name=5,7,24(28)-ergostatrienol|5-dehydro episterol}}
+
{{#set: consumed by=RXN-707}}
+
{{#set: produced by=RXN3O-218}}
+

Revision as of 17:56, 18 March 2018

Pathway LEU-DEG2-PWY

  • taxonomic range:
  • common name:
    • L-leucine degradation I
  • Synonym(s):

Reaction(s) found

6 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links