Difference between revisions of "RXN-14283"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] == * smiles: ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_12431 == * Synonym(s): == Reactions associated == * RXN-14480 ** pantograph-esiliculosus * RXN-14481 ** pantograph-e...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12431 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN-14480]] | |
− | + | ** [[pantograph]]-[[esiliculosus]] | |
− | * [[RXN- | + | * [[RXN-14481]] |
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN0-5063]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-14480|RXN-14481|RXN0-5063}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 17:56, 18 March 2018
Gene Tiso_gene_12431
- Synonym(s):