Difference between revisions of "Tiso gene 10501"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == * smiles: ** COC1(=C(O)C=CC(C(O)C=O)=C1) * inchi key: ** InChIKey=VISAJ...") |
(Created page with "Category:Gene == Gene Tiso_gene_6621 == * Synonym(s): == Reactions associated == * RXN-1882 ** pantograph-athaliana ** pantograph-esiliculosus * RXN...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6621 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN-1882]] | |
− | == | + | ** [[pantograph]]-[[athaliana]] |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
+ | * [[RXN-7771]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-7772]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY4FS-11]] | ||
+ | * [[PWY4FS-12]] | ||
+ | * [[PWY4FS-13]] | ||
+ | * [[PWY-5115]] | ||
+ | * [[PWY-882]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-1882|RXN-7771|RXN-7772}} | |
− | + | {{#set: pathway associated=PWY4FS-11|PWY4FS-12|PWY4FS-13|PWY-5115|PWY-882}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 18:56, 18 March 2018
Gene Tiso_gene_6621
- Synonym(s):