Difference between revisions of "RXN-15733"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * inchi key: ** InChIKey=ZUKPVRWZD...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7102 PWY-7102] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7102 PWY-7102] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
| − | * | + | |
* common name: | * common name: | ||
| − | ** | + | ** bisabolene biosynthesis (engineered) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN | + | '''3''' reactions found over '''6''' reactions in the full pathway |
| − | + | * [[FPPSYN-RXN]] | |
| − | * [[ | + | ** 1 associated gene(s): |
| − | * [[RXN- | + | *** [[Tiso_gene_16284]] |
| − | * [[RXN- | + | ** 4 reconstruction source(s) associated: |
| − | == Reaction(s) | + | *** [[orthology-athaliana]] |
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | *** [[manual-primary_network]] | ||
| + | * [[GPPSYN-RXN]] | ||
| + | ** 9 associated gene(s): | ||
| + | *** [[Tiso_gene_19542]] | ||
| + | *** [[Tiso_gene_18201]] | ||
| + | *** [[Tiso_gene_16284]] | ||
| + | *** [[Tiso_gene_2848]] | ||
| + | *** [[Tiso_gene_1035]] | ||
| + | *** [[Tiso_gene_4719]] | ||
| + | *** [[Tiso_gene_11582]] | ||
| + | *** [[Tiso_gene_13582]] | ||
| + | *** [[Tiso_gene_10317]] | ||
| + | ** 5 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | *** [[manual-primary_network]] | ||
| + | * [[IPPISOM-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_8653]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8429 RXN-8429] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8549 RXN-8549] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8550 RXN-8550] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: taxonomic range=TAX-1224}} | |
| − | + | {{#set: common name=bisabolene biosynthesis (engineered)}} | |
| − | + | {{#set: reaction found=3}} | |
| − | + | {{#set: total reaction=6}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 17:57, 18 March 2018
Pathway PWY-7102
Reaction(s) found
3 reactions found over 6 reactions in the full pathway
- FPPSYN-RXN
- 1 associated gene(s):
- 4 reconstruction source(s) associated:
- GPPSYN-RXN
- 9 associated gene(s):
- 5 reconstruction source(s) associated:
- IPPISOM-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
