Difference between revisions of "COUMARYL-ALCOHOL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALPHA-AMINO-EPSILON-KETO-PIMELATE L-ALPHA-AMINO-EPSILON-KETO-PIMELATE] == * smiles: ** C([O-]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9661 RXN-9661] == * direction: ** LEFT-TO-RIGHT * common name: ** trans dodec-2-enoyl-[acp] red...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALPHA-AMINO-EPSILON-KETO-PIMELATE L-ALPHA-AMINO-EPSILON-KETO-PIMELATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9661 RXN-9661] ==
−
* smiles:
+
* direction:
−
** C([O-])(=O)C(CCCC(C([O-])=O)=O)[N+]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=UKCSFKLWNHUBDY-BYPYZUCNSA-M
+
 
* common name:
 
* common name:
−
** L-α-amino-ε-keto-pimelate
+
** trans dodec-2-enoyl-[acp] reductase
−
* molecular weight:
+
* ec number:
−
** 188.16   
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
−
** L-2-Amino-6-oxopimelate
 
−
** L-2-Amino-6-oxoheptanedioate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[PROTON]][c] '''+''' 1 [[Dodec-2-enoyl-ACPs]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[Dodecanoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
−
* [[RXN-4821]]
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 a (2E)-dodec-2-enoyl-[acp][c] '''+''' 1 NADH[c] '''=>''' 1 a dodecanoyl-[acp][c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_10778]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202391 25202391]
+
{{#set: common name=trans dodec-2-enoyl-[acp] reductase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.3.1.9}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58556 58556]
+
{{#set: gene associated=Tiso_gene_10778}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-5971}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03871 C03871]
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=C([O-])(=O)C(CCCC(C([O-])=O)=O)[N+]}}
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
{{#set: inchi key=InChIKey=UKCSFKLWNHUBDY-BYPYZUCNSA-M}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=L-α-amino-ε-keto-pimelate}}
+
−
{{#set: molecular weight=188.16    }}
+
−
{{#set: common name=L-2-Amino-6-oxopimelate|L-2-Amino-6-oxoheptanedioate}}
+
−
{{#set: consumed or produced by=RXN-4821}}
+

Revision as of 17:57, 18 March 2018

Reaction RXN-9661

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans dodec-2-enoyl-[acp] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"trans dodec-2-enoyl-[acp] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=COUMARYL-ALCOHOL&oldid=20912"