Difference between revisions of "PWY-7204"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...") |
(Created page with "Category:Gene == Gene Tiso_gene_7350 == * left end position: ** 492 * transcription direction: ** NEGATIVE * right end position: ** 5446 * centisome position: ** 2.586071...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7350 == |
− | * | + | * left end position: |
− | ** | + | ** 492 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5446 |
− | * | + | * centisome position: |
− | ** | + | ** 2.586071 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[5.3.4.1-RXN]] | |
− | + | ** in-silico_annotation | |
− | * [[ | + | ***automated-name-match |
− | * [[ | + | ** experimental_annotation |
+ | ***automated-name-match | ||
+ | * [[DISULISOM-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | ** experimental_annotation | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=492}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5446}} | |
− | + | {{#set: centisome position=2.586071 }} | |
− | + | {{#set: reaction associated=5.3.4.1-RXN|DISULISOM-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:57, 18 March 2018
Gene Tiso_gene_7350
- left end position:
- 492
- transcription direction:
- NEGATIVE
- right end position:
- 5446
- centisome position:
- 2.586071
- Synonym(s):
Reactions associated
- 5.3.4.1-RXN
- in-silico_annotation
- automated-name-match
- experimental_annotation
- automated-name-match
- in-silico_annotation
- DISULISOM-RXN
- in-silico_annotation
- automated-name-match
- experimental_annotation
- automated-name-match
- in-silico_annotation