Difference between revisions of "RXN0-5038"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Tiso_gene_15422 == * left end position: ** 3274 * transcription direction: ** POSITIVE * right end position: ** 4726 * centisome position: ** 65.1153...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15422 == |
− | * | + | * left end position: |
− | ** | + | ** 3274 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4726 |
− | * | + | * centisome position: |
− | ** | + | ** 65.11536 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[3.3.2.8-RXN]] |
− | * [[ | + | ** in-silico_annotation |
− | + | ***automated-name-match | |
− | + | * [[RXN-9412]] | |
− | * [[ | + | ** in-silico_annotation |
− | * | + | ***automated-name-match |
− | * [[ | + | * [[RXN-9413]] |
− | * [[ | + | ** in-silico_annotation |
− | * [[ | + | ***automated-name-match |
+ | * [[RXN-9464]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5923]] | ||
+ | * [[PWY-5924]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3274}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4726}} | |
− | + | {{#set: centisome position=65.11536 }} | |
− | + | {{#set: reaction associated=3.3.2.8-RXN|RXN-9412|RXN-9413|RXN-9464}} | |
− | + | {{#set: pathway associated=PWY-5923|PWY-5924}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:58, 18 March 2018
Gene Tiso_gene_15422
- left end position:
- 3274
- transcription direction:
- POSITIVE
- right end position:
- 4726
- centisome position:
- 65.11536
- Synonym(s):
Reactions associated
- 3.3.2.8-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- RXN-9412
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- RXN-9413
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- RXN-9464
- in-silico_annotation
- automated-name-match
- in-silico_annotation