Difference between revisions of "Guanine9-in-tRNA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14877 CPD-14877] == * smiles: ** CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] == * smiles: ** C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1) * inchi key:...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=FPWMCUPFBRFMLH-XGAOUMNUSA-L |
* common name: | * common name: | ||
| − | ** | + | ** prephenate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 224.17 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PREPHENATEDEHYDROG-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[PREPHENATEDEHYDRAT-RXN]] |
| + | * [[CHORISMATEMUT-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 126-49-8 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460303 5460303] |
| − | {{#set: smiles= | + | * HMDB : HMDB12283 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00254 C00254] |
| − | {{#set: molecular weight= | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4573884.html 4573884] |
| − | {{#set: consumed or produced by=RXN- | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29934 29934] | ||
| + | * BIGG : pphn | ||
| + | {{#set: smiles=C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1)}} | ||
| + | {{#set: inchi key=InChIKey=FPWMCUPFBRFMLH-XGAOUMNUSA-L}} | ||
| + | {{#set: common name=prephenate}} | ||
| + | {{#set: molecular weight=224.17 }} | ||
| + | {{#set: consumed by=PREPHENATEDEHYDROG-RXN}} | ||
| + | {{#set: consumed or produced by=PREPHENATEDEHYDRAT-RXN|CHORISMATEMUT-RXN}} | ||
Revision as of 16:49, 10 January 2018
Contents
Metabolite PREPHENATE
- smiles:
- C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1)
- inchi key:
- InChIKey=FPWMCUPFBRFMLH-XGAOUMNUSA-L
- common name:
- prephenate
- molecular weight:
- 224.17
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 126-49-8
- PUBCHEM:
- HMDB : HMDB12283
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : pphn
"C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1)" cannot be used as a page name in this wiki.
