Difference between revisions of "Tiso gene 3322"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_14441 == * Synonym(s): == Reactions associated == * 2.7.1.121-RXN ** pantograph-creinhardtii * GLYCERONE-KINASE-RXN ** in-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_14441 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * [[2.7.1.121-RXN]] |
| − | * [[RXN- | + | ** [[pantograph]]-[[creinhardtii]] |
| − | == | + | * [[GLYCERONE-KINASE-RXN]] |
| − | * [[ | + | ** in-silico_annotation |
| − | + | ***ec-number | |
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways associated == | ||
| + | * [[PWY-6131]] | ||
| + | * [[P185-PWY]] | ||
| + | * [[GLYCEROLMETAB-PWY]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=2.7.1.121-RXN|GLYCERONE-KINASE-RXN}} | |
| − | + | {{#set: pathway associated=PWY-6131|P185-PWY|GLYCEROLMETAB-PWY}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 15:49, 10 January 2018
Gene Tiso_gene_14441
- Synonym(s):
Reactions associated
- 2.7.1.121-RXN
- GLYCERONE-KINASE-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
