Difference between revisions of "PWY-5538"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18092 RXN-18092] == * direction: ** LEFT-TO-RIGHT * common name: ** gamma-glutamyl_transferase...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18092 RXN-18092] ==
* smiles:
+
* direction:
** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N
+
 
* common name:
 
* common name:
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
+
** gamma-glutamyl_transferase
* molecular weight:
+
* ec number:
** 444.74   
+
** [http://enzyme.expasy.org/EC/2.3.2.2 EC-2.3.2.2]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN66-12]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[GLYCYLGLYCINE]][c] '''+''' 1 [[GLUTATHIONE]][c] '''=>''' 1 [[CPD-19395]][c] '''+''' 1 [[CYS-GLY]][c]
* [[RXN66-11]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 glycyl-glycine[c] '''+''' 1 glutathione[c] '''=>''' 1 γ-L-glutamyl-glycylglycine[c] '''+''' 1 L-cysteinyl-glycine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_12321]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698821 15698821]
+
{{#set: common name=gamma-glutamyl_transferase}}
* CHEBI:
+
{{#set: ec number=EC-2.3.2.2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87057 87057]
+
{{#set: gene associated=Tiso_gene_12321}}
* HMDB : HMDB12160
+
{{#set: in pathway=}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: reconstruction category=annotation}}
{{#set: inchi key=InChIKey=SJPDNXKPBQHPMZ-PUXRVUTHSA-N}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: molecular weight=444.74    }}
+
{{#set: consumed by=RXN66-12}}
+
{{#set: produced by=RXN66-11}}
+

Revision as of 18:00, 18 March 2018

Reaction RXN-18092

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • gamma-glutamyl_transferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 glycyl-glycine[c] + 1 glutathione[c] => 1 γ-L-glutamyl-glycylglycine[c] + 1 L-cysteinyl-glycine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links