Difference between revisions of "NONAPRENYL-4-HYDROXYBENZOATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14877 CPD-14877] == * smiles: ** CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1) * inchi key: ** InChIKe...")
(Created page with "Category:Gene == Gene Tiso_gene_15498 == * left end position: ** 983 * transcription direction: ** POSITIVE * right end position: ** 2829 * centisome position: ** 19.67968...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14877 CPD-14877] ==
+
== Gene Tiso_gene_15498 ==
−
* smiles:
+
* left end position:
−
** CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1)
+
** 983
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BXBFVCYLJXGOGI-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-acetylamino-4-hydroxybenzoate
+
** 2829
−
* molecular weight:
+
* centisome position:
−
** 194.166    
+
** 19.67968    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-acetylamino-4-hydroxybenzoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** in-silico_annotation
−
* [[RXN-13870]]
+
***ec-number
 +
* [[GPH-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-181]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=983}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657256 90657256]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1)}}
+
{{#set: right end position=2829}}
−
{{#set: inchi key=InChIKey=BXBFVCYLJXGOGI-UHFFFAOYSA-M}}
+
{{#set: centisome position=19.67968   }}
−
{{#set: common name=3-acetylamino-4-hydroxybenzoate}}
+
{{#set: reaction associated=4-NITROPHENYLPHOSPHATASE-RXN|GPH-RXN}}
−
{{#set: molecular weight=194.166   }}
+
{{#set: pathway associated=PWY-181}}
−
{{#set: common name=3-acetylamino-4-hydroxybenzoic acid}}
+
−
{{#set: consumed or produced by=RXN-13870}}
+

Revision as of 18:01, 18 March 2018

Gene Tiso_gene_15498

  • left end position:
    • 983
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2829
  • centisome position:
    • 19.67968
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=NONAPRENYL-4-HYDROXYBENZOATE&oldid=21284"