Difference between revisions of "RXN-9624"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-2-enoyl-CoAs Cis-2-enoyl-CoAs] == * common name: ** a cis-2-enoyl-CoA * Synonym(s): == Rea...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-2-enoyl-CoAs Cis-2-enoyl-CoAs] ==
* smiles:
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
+
* inchi key:
+
** InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
+
 
* common name:
 
* common name:
** quinoxaline-2-carboxyl adenylate
+
** a cis-2-enoyl-CoA
* molecular weight:
+
** 502.359   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17155]]
+
* [[RXN-7838]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a cis-2-enoyl-CoA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515331 102515331]
+
{{#set: consumed by=RXN-7838}}
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O}}
+
{{#set: inchi key=InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M}}
+
{{#set: common name=quinoxaline-2-carboxyl adenylate}}
+
{{#set: molecular weight=502.359    }}
+
{{#set: consumed by=RXN-17155}}
+

Revision as of 18:04, 18 March 2018

Metabolite Cis-2-enoyl-CoAs

  • common name:
    • a cis-2-enoyl-CoA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links