Difference between revisions of "PWY-6525"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-686 RXN1G-686] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis,cis-delta9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=SYKWLIJQEHRDNH-CKRMAKSASA-I | ||
* common name: | * common name: | ||
− | ** | + | ** glutaryl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 876.595 |
* Synonym(s): | * Synonym(s): | ||
+ | ** glutaryl-coenzyme A | ||
+ | ** 4-carboxybutanoyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[2-KETO-ADIPATE-DEHYDROG-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-8032]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00527 C00527] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57378 57378] |
− | {{#set: | + | * METABOLIGHTS : MTBLC57378 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266604 45266604] |
− | {{#set: | + | * HMDB : HMDB01339 |
+ | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=SYKWLIJQEHRDNH-CKRMAKSASA-I}} | ||
+ | {{#set: common name=glutaryl-CoA}} | ||
+ | {{#set: molecular weight=876.595 }} | ||
+ | {{#set: common name=glutaryl-coenzyme A|4-carboxybutanoyl-CoA}} | ||
+ | {{#set: produced by=2-KETO-ADIPATE-DEHYDROG-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-8032}} |
Revision as of 19:05, 18 March 2018
Contents
Metabolite GLUTARYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=SYKWLIJQEHRDNH-CKRMAKSASA-I
- common name:
- glutaryl-CoA
- molecular weight:
- 876.595
- Synonym(s):
- glutaryl-coenzyme A
- 4-carboxybutanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.