Difference between revisions of "GLYCOLATEMET-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * inchi key: ** InChIKe...")
(Created page with "Category:Gene == Gene Tiso_gene_2034 == * left end position: ** 9085 * transcription direction: ** NEGATIVE * right end position: ** 13886 * centisome position: ** 43.7052...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] ==
+
== Gene Tiso_gene_2034 ==
* smiles:
+
* left end position:
** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)
+
** 9085
* inchi key:
+
* transcription direction:
** InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M
+
** NEGATIVE
* common name:
+
* right end position:
** 2-carboxy-L-xylonolactone
+
** 13886
* molecular weight:
+
* centisome position:
** 191.117    
+
** 43.7052    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12871]]
+
* [[3.1.3.16-RXN]]
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
* [[RXN-12870]]
+
***automated-name-match
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=9085}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658445 90658445]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)}}
+
{{#set: right end position=13886}}
{{#set: inchi key=InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M}}
+
{{#set: centisome position=43.7052   }}
{{#set: common name=2-carboxy-L-xylonolactone}}
+
{{#set: reaction associated=3.1.3.16-RXN}}
{{#set: molecular weight=191.117   }}
+
{{#set: consumed by=RXN-12871}}
+
{{#set: produced by=RXN-12870}}
+

Revision as of 19:06, 18 March 2018

Gene Tiso_gene_2034

  • left end position:
    • 9085
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 13886
  • centisome position:
    • 43.7052
  • Synonym(s):

Reactions associated

Pathways associated

External links