Difference between revisions of "IS30-Insertion-Sequences"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] == * smiles: ** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACHMSSELCYSLh ACHMSSELCYSLh] == * direction: ** LEFT-TO-RIGHT * common name: ** O-Acetylhomoserine...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACHMSSELCYSLh ACHMSSELCYSLh] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J
+
 
* common name:
 
* common name:
−
** (2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA
+
** O-Acetylhomoserine succinate-lyase (adding cysteine), chloroplast
−
* molecular weight:
+
−
** 1051.975   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16097]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[L-SELENOCYSTEINE]][h] '''+''' 1.0 [[CPD-667]][h] '''=>''' 1.0 [[CPD-13717]][h] '''+''' 1.0 [[ACET]][h]
−
* [[RXN-16096]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 L-selenocysteine[h] '''+''' 1.0 O-acetyl-L-homoserine[h] '''=>''' 1.0 L-selenocystathionine[h] '''+''' 1.0 acetate[h]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_3732]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193765 72193765]
+
{{#set: common name=O-Acetylhomoserine succinate-lyase (adding cysteine), chloroplast}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_3732}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76409 76409]
+
{{#set: in pathway=}}
−
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=(2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=1051.975    }}
+
−
{{#set: consumed by=RXN-16097}}
+
−
{{#set: produced by=RXN-16096}}
+

Revision as of 19:06, 18 March 2018

Reaction ACHMSSELCYSLh

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • O-Acetylhomoserine succinate-lyase (adding cysteine), chloroplast
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 L-selenocysteine[h] + 1.0 O-acetyl-L-homoserine[h] => 1.0 L-selenocystathionine[h] + 1.0 acetate[h]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=IS30-Insertion-Sequences&oldid=21948"