Difference between revisions of "1-CHLORO-24-DINITROBENZENE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=EPMEACPR EPMEACPR] == * direction: ** LEFT-TO-RIGHT * common name: ** Enoylpimeloyl-[ACP] methyl es...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TAGATURONATE D-TAGATURONATE] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** I...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=EPMEACPR EPMEACPR] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TAGATURONATE D-TAGATURONATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C(=O)C(O)C(O)C(O)C(=O)[O-]
 +
* inchi key:
 +
** InChIKey=IZSRJDGCGRAUAR-WDCZJNDASA-M
 
* common name:
 
* common name:
−
** Enoylpimeloyl-[ACP] methyl ester reductase
+
** D-tagaturonate
 +
* molecular weight:
 +
** 193.133   
 
* Synonym(s):
 
* Synonym(s):
 +
** tagaturonate
 +
** D-arabino-hex-5-ulosonate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[Enoylpimeloyl-ACP-methyl-esters]][m] '''+''' 1.0 [[PROTON]][m] '''+''' 1.0 [[NADPH]][m] '''=>''' 1.0 [[Pimeloyl-ACP-methyl-esters]][m] '''+''' 1.0 [[NADP]][m]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[GALACTUROISOM-RXN]]
−
** 1.0 an enoylpimeloyl-[acp] methyl ester[m] '''+''' 1.0 H+[m] '''+''' 1.0 NADPH[m] '''=>''' 1.0 a pimeloyl-[acp] methyl ester[m] '''+''' 1.0 NADP+[m]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10778]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Enoylpimeloyl-[ACP] methyl ester reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460108 5460108]
−
{{#set: gene associated=Tiso_gene_10778}}
+
* CHEMSPIDER:
−
{{#set: in pathway=}}
+
** [http://www.chemspider.com/Chemical-Structure.4573770.html 4573770]
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17886 17886]
−
{{#set: reconstruction source=creinhardtii}}
+
* BIGG : tagur
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00558 C00558]
 +
{{#set: smiles=C(O)C(=O)C(O)C(O)C(O)C(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=IZSRJDGCGRAUAR-WDCZJNDASA-M}}
 +
{{#set: common name=D-tagaturonate}}
 +
{{#set: molecular weight=193.133    }}
 +
{{#set: common name=tagaturonate|D-arabino-hex-5-ulosonate}}
 +
{{#set: reversible reaction associated=GALACTUROISOM-RXN}}

Revision as of 18:06, 18 March 2018

Metabolite D-TAGATURONATE

  • smiles:
    • C(O)C(=O)C(O)C(O)C(O)C(=O)[O-]
  • inchi key:
    • InChIKey=IZSRJDGCGRAUAR-WDCZJNDASA-M
  • common name:
    • D-tagaturonate
  • molecular weight:
    • 193.133
  • Synonym(s):
    • tagaturonate
    • D-arabino-hex-5-ulosonate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(=O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=1-CHLORO-24-DINITROBENZENE&oldid=22029"