Difference between revisions of "CPD-19163"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-N-UBIQUITYL-LYSINE PROTEIN-N-UBIQUITYL-LYSINE] == * common name: ** an N6-monoubiquitin...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] == * smiles: ** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] == |
+ | * smiles: | ||
+ | ** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 3-oxododecanoyl-CoA |
+ | * molecular weight: | ||
+ | ** 959.791 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-oxolauroyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[HACD5m]] | ||
+ | * [[RXN-14274]] | ||
+ | * [[HACD5]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: produced by= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05263 C05263] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62615 62615] | ||
+ | * BIGG : 3oddcoa | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173506 46173506] | ||
+ | * HMDB : HMDB03937 | ||
+ | {{#set: smiles=CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J}} | ||
+ | {{#set: common name=3-oxododecanoyl-CoA}} | ||
+ | {{#set: molecular weight=959.791 }} | ||
+ | {{#set: common name=3-oxolauroyl-CoA}} | ||
+ | {{#set: consumed or produced by=HACD5m|RXN-14274|HACD5}} |
Revision as of 15:50, 10 January 2018
Contents
Metabolite CPD0-2105
- smiles:
- CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J
- common name:
- 3-oxododecanoyl-CoA
- molecular weight:
- 959.791
- Synonym(s):
- 3-oxolauroyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.