Difference between revisions of "Tiso gene 17319"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8984 CPD-8984] == * smiles: ** C3(C=CC(C2(C(C1(C=CC=CC=1))O2))=CC=3) * inchi key: ** InChIK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8984 CPD-8984] == * smiles: ** C3(C=CC(C2(C(C1(C=CC=CC=1))O2))=CC=3) * inchi key: ** InChIK...") |
||
| Line 29: | Line 29: | ||
{{#set: common name=cis-stilbene oxide}} | {{#set: common name=cis-stilbene oxide}} | ||
{{#set: molecular weight=196.248 }} | {{#set: molecular weight=196.248 }} | ||
| − | {{#set: | + | {{#set: reversible reaction associated=3.3.2.9-RXN}} |
Revision as of 18:07, 18 March 2018
Contents
Metabolite CPD-8984
- smiles:
- C3(C=CC(C2(C(C1(C=CC=CC=1))O2))=CC=3)
- inchi key:
- InChIKey=ARCJQKUWGAZPFX-OKILXGFUSA-N
- common name:
- cis-stilbene oxide
- molecular weight:
- 196.248
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
