Difference between revisions of "PWY-5175"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == * smiles: ** CC(=CCCC(=CCOP([O-])(OP(=O)([O-])[O-])=O)C)C * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7619 PWY-7619] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7619 PWY-7619] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** juniperonate biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 5,11,14,17-icosatetraenoic acid biosynthesis |
| − | ** | + | ** 5,11,14,17-icosatetraenoate biosynthesis |
| − | ** | + | ** juniperonic acid biosynthesis |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''4''' reactions found over '''5''' reactions in the full pathway |
| − | * [[ | + | * [[RXN-12994]] |
| − | + | ** 3 associated gene(s): | |
| − | * [[ | + | *** [[Tiso_gene_9885]] |
| − | == Reaction(s) | + | *** [[Tiso_gene_13083]] |
| − | * [ | + | *** [[Tiso_gene_9871]] |
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-12997]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RXN-13001]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RXN-13441]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11678 RXN-11678] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=juniperonate biosynthesis}} | |
| − | + | {{#set: common name=5,11,14,17-icosatetraenoic acid biosynthesis|5,11,14,17-icosatetraenoate biosynthesis|juniperonic acid biosynthesis}} | |
| − | + | {{#set: reaction found=4}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=80.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:07, 18 March 2018
Pathway PWY-7619
- taxonomic range:
- common name:
- juniperonate biosynthesis
- Synonym(s):
- 5,11,14,17-icosatetraenoic acid biosynthesis
- 5,11,14,17-icosatetraenoate biosynthesis
- juniperonic acid biosynthesis
Reaction(s) found
4 reactions found over 5 reactions in the full pathway
- RXN-12994
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-12997
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-13001
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-13441
- 0 associated gene:
- 1 reconstruction source(s) associated:
