Difference between revisions of "R4-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] == * smiles: ** C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-containing-5Me-uridine54 tRNA-containing-5Me-uridine54] == * common name: ** a 5-methylura...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-containing-5Me-uridine54 tRNA-containing-5Me-uridine54] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a 5-methyluracil54 in tRNA |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** a tRNA containing 5-methyluracil54 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[TRNA-URACIL-5--METHYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=a 5-methyluracil54 in tRNA}} | |
− | + | {{#set: common name=a tRNA containing 5-methyluracil54}} | |
− | + | {{#set: produced by=TRNA-URACIL-5--METHYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 19:07, 18 March 2018
Contents
Metabolite tRNA-containing-5Me-uridine54
- common name:
- a 5-methyluracil54 in tRNA
- Synonym(s):
- a tRNA containing 5-methyluracil54