Difference between revisions of "VERY-LONG-CHAIN-FATTY-ACYL-COA"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4460 == * Synonym(s): == Reactions associated == * RXN-15556 ** in-silico_annotation ***ec-number * UBIQUITIN--PROTEIN-LIGASE-RXN...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] == * smiles: ** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] == |
+ | * smiles: | ||
+ | ** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-])) | ||
+ | * inchi key: | ||
+ | ** InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M | ||
+ | * common name: | ||
+ | ** 5-hydroxyindole acetate | ||
+ | * molecular weight: | ||
+ | ** 190.178 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-hydroxyindoleacetic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10780]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 54-16-0 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3772821 3772821] | ||
+ | * HMDB : HMDB00763 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05635 C05635] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.3001356.html 3001356] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62622 62622] | ||
+ | {{#set: smiles=C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))}} | ||
+ | {{#set: inchi key=InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=5-hydroxyindole acetate}} | ||
+ | {{#set: molecular weight=190.178 }} | ||
+ | {{#set: common name=5-hydroxyindoleacetic acid}} | ||
+ | {{#set: produced by=RXN-10780}} |
Revision as of 18:08, 18 March 2018
Contents
Metabolite 5-HYDROXYINDOLE_ACETATE
- smiles:
- C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))
- inchi key:
- InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M
- common name:
- 5-hydroxyindole acetate
- molecular weight:
- 190.178
- Synonym(s):
- 5-hydroxyindoleacetic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))" cannot be used as a page name in this wiki.