Difference between revisions of "PWY-7431"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17263 CPD-17263] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=LCYSDEG-PWY LCYSDEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17263 CPD-17263] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=LCYSDEG-PWY LCYSDEG-PWY] ==
* smiles:
+
* taxonomic range:
** CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
** InChIKey=PCGPHLMAAZKQFQ-FPXDADDUSA-J
+
 
* common name:
 
* common name:
** (8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA
+
** L-cysteine degradation II
* molecular weight:
+
** 1065.958   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-hydroxy-eicosatetraenoyl-CoA
+
** L-cysteine catabolism
 +
** L-cysteine degradation
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''3''' reactions in the full pathway
* [[RXN-16020]]
+
* [[RXN-15124]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-15127]]
 +
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-15129]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3732]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819744 91819744]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=LCYSDEG-PWY LCYSDEG-PWY]
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: inchi key=InChIKey=PCGPHLMAAZKQFQ-FPXDADDUSA-J}}
+
{{#set: taxonomic range=TAX-2759}}
{{#set: common name=(8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA}}
+
{{#set: common name=L-cysteine degradation II}}
{{#set: molecular weight=1065.958    }}
+
{{#set: common name=L-cysteine catabolism|L-cysteine degradation}}
{{#set: common name=3-hydroxy-eicosatetraenoyl-CoA}}
+
{{#set: reaction found=3}}
{{#set: produced by=RXN-16020}}
+
{{#set: total reaction=3}}
 +
{{#set: completion rate=100.0}}

Revision as of 18:09, 18 March 2018

Pathway LCYSDEG-PWY

  • taxonomic range:
  • common name:
    • L-cysteine degradation II
  • Synonym(s):
    • L-cysteine catabolism
    • L-cysteine degradation

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links