|
|
Line 1: |
Line 1: |
− | [[Category:Metabolite]] | + | [[Category:Reaction]] |
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CO-A CO-A] == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PSERPHOSPHA-RXN PSERPHOSPHA-RXN] == |
− | * smiles: | + | * direction: |
− | ** CC(C)(C(O)C(=O)NCCC(=O)NCCS)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | + | ** LEFT-TO-RIGHT |
− | * inchi key:
| + | |
− | ** InChIKey=RGJOEKWQDUBAIZ-IBOSZNHHSA-J
| + | |
| * common name: | | * common name: |
− | ** coenzyme A | + | ** phosphoserine_chloroplastic |
− | * molecular weight: | + | * ec number: |
− | ** 763.502 | + | ** [http://enzyme.expasy.org/EC/3.1.3.3 EC-3.1.3.3] |
| * Synonym(s): | | * Synonym(s): |
− | ** CoA
| |
− | ** co-A-SH
| |
− | ** co-enzyme-A
| |
− | ** co-A
| |
− | ** HS-CoA
| |
| | | |
− | == Reaction(s) known to consume the compound == | + | == Reaction Formula == |
− | * [[RXN-2006]] | + | * With identifiers: |
− | * [[RXN66-483]] | + | ** 1 [[Phosphoserines]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Serines]][c] '''+''' 1 [[Pi]][c] |
− | * [[RXN66-480]] | + | * With common name(s): |
− | * [[RXN-16561]]
| + | ** 1 L(or D)-O-phosphoserine[c] '''+''' 1 H+[c] '''+''' 1 H2O[c] '''=>''' 1 serine[c] '''+''' 1 phosphate[c] |
− | * [[RXN66-469]]
| + | |
− | * [[RXN66-484]]
| + | == Genes associated with this reaction == |
− | * [[RXN-16418]]
| + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[RXN-17116]]
| + | * [[Tiso_gene_6236]] |
− | * [[RXN-1126]]
| + | ** IN-SILICO_ANNOTATION |
− | * [[RXN0-7248]]
| + | ***EC-NUMBER |
− | * [[2.3.1.176-RXN]]
| + | ** EXPERIMENTAL_ANNOTATION |
− | * [[RXN-14268]]
| + | ***EC-NUMBER |
− | * [[RXN-2001]]
| + | ** [[pantograph]]-[[esiliculosus]] |
− | * [[RXN-16389]]
| + | == Pathways == |
− | * [[ACYLCOASYN-RXN]]
| + | == Reconstruction information == |
− | * [[RXN-17791]]
| + | * Category: [[orthology]] |
− | * [[RXN3O-5304]]
| + | ** Source: [[orthology-esiliculosus]] |
− | * [[RXN-11921]]
| + | *** Tool: [[pantograph]] |
− | * [[RXN-16380]]
| + | * Category: [[annotation]] |
− | * [[LNLNCACOAL]]
| + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[RXN-10919]]
| + | *** Tool: [[pathwaytools]] |
− | * [[RXN-13617]]
| + | ** Source: [[annotation-experimental_annotation]] |
− | * [[ACETATE--COA-LIGASE-RXN]]
| + | *** Tool: [[pathwaytools]] |
− | * [[RXN3O-9780]]
| + | |
− | * [[RXN-10699]]
| + | |
− | * [[RXN-9673]]
| + | |
− | * [[BNorh]]
| + | |
− | * [[RXN-16401]]
| + | |
− | * [[RXN-8988]]
| + | |
− | * [[PYRUVDEH-RXN]]
| + | |
− | * [[RXN-15889]]
| + | |
− | * [[RXN-17795]]
| + | |
− | * [[RXN-13614]]
| + | |
− | * [[DHRT_2mbcoa]]
| + | |
− | * [[RXN-16137]]
| + | |
− | * [[2KETO-4METHYL-PENTANOATE-DEHYDROG-RXN]]
| + | |
− | * [[RXN-12978]]
| + | |
− | * [[DHRT_ibcoa]]
| + | |
− | * [[TRANS-RXN0-623]]
| + | |
− | * [[RXN-17799]]
| + | |
− | * [[RXN-17778]]
| + | |
− | * [[RXN-7904]]
| + | |
− | * [[RXN66-474]]
| + | |
− | * [[RXN-10695]]
| + | |
− | * [[RXN-14793]]
| + | |
− | * [[KETOACYLCOATHIOL-RXN]]
| + | |
− | * [[2.3.1.155-RXN]]
| + | |
− | * [[ACCAT]]
| + | |
− | * [[RXN-13290]]
| + | |
− | * [[RXN-11213]]
| + | |
− | * [[RXN66-477]]
| + | |
− | * [[RXN-14799]]
| + | |
− | * [[AKBLIG-RXN]]
| + | |
− | * [[RXN-12184]]
| + | |
− | * [[RXN-14774]]
| + | |
− | * [[RXN-17787]]
| + | |
− | * [[BNor]]
| + | |
− | * [[LNLCCOAL]]
| + | |
− | * [[LINOLENOYL-RXN]]
| + | |
− | * [[RXN0-7239]]
| + | |
− | * [[RXN-12710]]
| + | |
− | * [[RXN-14803]]
| + | |
− | * [[RXN-16393]]
| + | |
− | * [[HOLO-ACP-SYNTH-RXN]]
| + | |
− | * [[R223-RXN]]
| + | |
− | * [[RXN-2902]]
| + | |
− | * [[RXN-11917]]
| + | |
− | * [[RXN-17782]]
| + | |
− | * [[RXN-10700]]
| + | |
− | * [[RXN-10701]]
| + | |
− | * [[RXN-9644]]
| + | |
− | * [[RXN-11246]]
| + | |
− | * [[1.2.1.27-RXN]]
| + | |
− | * [[RXN0-7238]]
| + | |
− | * [[RXN-14394]]
| + | |
− | * [[RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.]]
| + | |
− | * [[RXN-14788]]
| + | |
− | * [[6.2.1.34-RXN]]
| + | |
− | * [[2-KETO-ADIPATE-DEHYDROG-RXN]]
| + | |
− | * [[RXN-9623]]
| + | |
− | * [[FACOAL18111Z]] | + | |
− | * [[ENTDB-RXN]] | + | |
− | * [[4-COUMARATE--COA-LIGASE-RXN]] | + | |
− | * [[1.2.1.25-RXN]]
| + | |
− | * [[RXN-16402]]
| + | |
− | == Reaction(s) known to produce the compound ==
| + | |
− | * [[DEPHOSPHOCOAKIN-RXN]]
| + | |
− | * [[IPMS]]
| + | |
− | * [[RXN-10821]]
| + | |
− | * [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]]
| + | |
− | * [[RXN-12565]]
| + | |
− | * [[RXN-17729]]
| + | |
− | * [[FATTY-ACYL-COA-SYNTHASE-RXN]]
| + | |
− | * [[THIOESTER-RXN]]
| + | |
− | * [[RXN-16118]]
| + | |
− | * [[MALSYN-RXN]]
| + | |
− | * [[RXN-3142]]
| + | |
− | * [[RXN-15044]]
| + | |
− | * [[RXN-15045]]
| + | |
− | * [[RXN-15043]]
| + | |
− | * [[RXN0-6948]]
| + | |
− | * [[RXN-17855]]
| + | |
− | * [[RXN-17854]]
| + | |
− | * [[RXN-17857]]
| + | |
− | * [[RXN-17856]]
| + | |
− | * [[RXN-17851]]
| + | |
− | * [[RXN-17850]]
| + | |
− | * [[RXN-17853]]
| + | |
− | * [[RXN-17852]]
| + | |
− | * [[RXN-17859]]
| + | |
− | * [[RXN-17858]]
| + | |
− | * [[RXN-9629]]
| + | |
− | * [[FACOAE1839Z12Z15Z]]
| + | |
− | * [[RXN1G-445]]
| + | |
− | * [[RXN-16100]]
| + | |
− | * [[RXN-1106]]
| + | |
− | * [[RXN3DJ-118]]
| + | |
− | * [[RXN-1101]]
| + | |
− | * [[RXN1G-368]]
| + | |
− | * [[2.3.1.165-RXN]]
| + | |
− | * [[RXN-12547]]
| + | |
− | * [[RXN-9627]]
| + | |
− | * [[RXN-13322]]
| + | |
− | * [[RXN-9632]]
| + | |
− | * [[RXN-9624]]
| + | |
− | * [[2-ISOPROPYLMALATESYN-RXN]]
| + | |
− | * [[RXN-17021]]
| + | |
− | * [[RXN-17023]]
| + | |
− | * [[RXN-7697]]
| + | |
− | * [[DIHYDLIPACETRANS-RXN]]
| + | |
− | * [[RXN-15090]]
| + | |
− | * [[CITSYN-RXN]]
| + | |
− | * [[CSm]]
| + | |
− | * [[RXN-9648]]
| + | |
− | * [[RXN-6384]]
| + | |
− | * [[RXN-1623]]
| + | |
− | * [[CSx]]
| + | |
− | * [[RXN-13721]]
| + | |
− | * [[RXN-13435]]
| + | |
− | * [[RXN-13431]]
| + | |
− | * [[RXN-13430]]
| + | |
− | * [[RXN-16082]]
| + | |
− | * [[ACYL-COA-HYDROLASE-RXN]]
| + | |
− | * [[7KAPSYN-RXN]]
| + | |
− | * [[2.3.1.118-RXN]]
| + | |
− | * [[RXN-9652]]
| + | |
− | * [[RXN-9651]]
| + | |
− | * [[RXN-9650]]
| + | |
− | * [[RXN-17864]]
| + | |
− | * [[RXN-9654]]
| + | |
− | * [[RXN-17860]]
| + | |
− | * [[RXN-17861]]
| + | |
− | * [[RXN-17862]]
| + | |
− | * [[RXN-17863]]
| + | |
− | * [[RXN-9543]]
| + | |
− | * [[RXN-9653]]
| + | |
− | * [[ISOVALERYLCOA-DHLIPOAMIDE-RXN]]
| + | |
− | * [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
| + | |
− | * [[RXN-16094]]
| + | |
− | * [[RXN-16098]]
| + | |
− | * [[ACACT7m]]
| + | |
− | * [[ACDHmi]]
| + | |
− | * [[ACACT]]
| + | |
− | * [[RXN-13297]]
| + | |
− | * [[RXN-13296]]
| + | |
− | * [[RXN-13295]]
| + | |
− | * [[RXN-13294]]
| + | |
− | * [[HICH]]
| + | |
− | * [[RXN-16017]]
| + | |
− | * [[RXN1G-499]]
| + | |
− | * [[RXN-9666]]
| + | |
− | * [[ARYLAMINE-N-ACETYLTRANSFERASE-RXN]]
| + | |
− | * [[RXN-10708]]
| + | |
− | * [[RXN0-1133]]
| + | |
− | * [[LINOLEOYL-RXN]]
| + | |
− | * [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
| + | |
− | * [[RXN-17011]]
| + | |
− | * [[RXN-17010]]
| + | |
− | * [[RXN-17019]]
| + | |
− | * [[MALONYL-COA-ACP-TRANSACYL-RXN]]
| + | |
− | * [[ACDHi]]
| + | |
− | * [[ADCPT]]
| + | |
− | * [[2.3.1.180-RXN]]
| + | |
− | * [[RXN-13446]]
| + | |
− | * [[RXN-13442]]
| + | |
− | * [[RXN-13441]]
| + | |
− | * [[RXN-7743]]
| + | |
− | * [[RXN-10059]]
| + | |
− | * [[RXN-17008]]
| + | |
− | * [[RXN-17009]]
| + | |
− | * [[RXN-16032]]
| + | |
− | * [[RXN-12362]]
| + | |
− | * [[RXN-12363]]
| + | |
− | * [[RXN-1381]]
| + | |
− | * [[GLUCOSAMINEPNACETYLTRANS-RXN]]
| + | |
− | * [[RXN-9192]]
| + | |
− | * [[SERINE-O-ACETTRAN-RXN]]
| + | |
− | * [[PALMITOYL-COA-HYDROLASE-RXN]]
| + | |
− | == Reaction(s) of unknown directionality == | + | |
− | * [[RXN-16759]]
| + | |
− | * [[RXN1G-460]]
| + | |
− | * [[RXN-16063]]
| + | |
− | * [[RXN-1124]]
| + | |
− | * [[2.3.1.168-RXN]]
| + | |
− | * [[RXN-16066]] | + | |
− | * [[TUBULIN-N-ACETYLTRANSFERASE-RXN]] | + | |
− | * [[ACCOAtx]] | + | |
− | * [[RXN-16103]]
| + | |
− | * [[RXN-10994]] | + | |
− | * [[RXN-16415]] | + | |
− | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] | + | |
− | * [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]] | + | |
− | * [[2.3.1.97-RXN]] | + | |
− | * [[1.1.1.34-RXN]] | + | |
− | * [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]] | + | |
− | * [[RXN-13671]] | + | |
− | * [[RXN-12561]] | + | |
− | * [[RXN-15036]] | + | |
− | * [[RXN-13871]]
| + | |
− | * [[2KETO-3METHYLVALERATE-RXN]]
| + | |
− | * [[HISTONE-ACETYLTRANSFERASE-RXN]]
| + | |
− | * [[RXN-14274]]
| + | |
− | * [[RXN-14277]] | + | |
− | * [[RXN0-1147]] | + | |
− | * [[ACCOAth]]
| + | |
− | * [[RXN-8032]] | + | |
− | * [[ACACT6]] | + | |
− | * [[ACACT7]] | + | |
− | * [[ACACT4]] | + | |
− | * [[ACCOAtm]] | + | |
− | * [[2.3.1.23-RXN]] | + | |
− | * [[ACETYL-COA-ACETYLTRANSFER-RXN]] | + | |
− | * [[RXN-13870]] | + | |
− | * [[AKGDHe2r]] | + | |
− | * [[RXN-13112]] | + | |
− | * [[ALCOHOL-O-ACETYLTRANSFERASE-RXN]] | + | |
− | * [[METHYLACETOACETYLCOATHIOL-RXN]] | + | |
− | * [[N-ACETYLTRANSFER-RXN]] | + | |
− | * [[ACP-S-ACETYLTRANSFER-RXN]] | + | |
− | * [[SUCL_gdp_m]] | + | |
− | * [[RXN-15066]]
| + | |
− | * [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
| + | |
− | * [[SUCCCOASYN-RXN]]
| + | |
− | * [[ACETALD-DEHYDROG-RXN]]
| + | |
| == External links == | | == External links == |
− | * CAS : 85-61-0 | + | * UNIPROT: |
− | * Wikipedia : Coenzyme_a | + | ** [http://www.uniprot.org/uniprot/Q58989 Q58989] |
− | * METABOLIGHTS : MTBLC57287 | + | ** [http://www.uniprot.org/uniprot/O25367 O25367] |
− | * PUBCHEM: | + | ** [http://www.uniprot.org/uniprot/Q9JUR1 Q9JUR1] |
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25113190 25113190] | + | ** [http://www.uniprot.org/uniprot/Q9CHW3 Q9CHW3] |
− | * KNAPSACK : C00007258 | + | ** [http://www.uniprot.org/uniprot/Q9PIL4 Q9PIL4] |
− | * HMDB : HMDB01423 | + | ** [http://www.uniprot.org/uniprot/P44997 P44997] |
− | * LIGAND-CPD: | + | ** [http://www.uniprot.org/uniprot/P0AGB0 P0AGB0] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?C00010 C00010] | + | ** [http://www.uniprot.org/uniprot/P42941 P42941] |
− | * CHEBI: | + | ** [http://www.uniprot.org/uniprot/Q49823 Q49823] |
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57287 57287] | + | ** [http://www.uniprot.org/uniprot/O82796 O82796] |
− | * BIGG : coa | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCS)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | + | {{#set: common name=phosphoserine_chloroplastic}} |
− | {{#set: inchi key=InChIKey=RGJOEKWQDUBAIZ-IBOSZNHHSA-J}} | + | {{#set: ec number=EC-3.1.3.3}} |
− | {{#set: common name=coenzyme A}} | + | {{#set: gene associated=Tiso_gene_6236}} |
− | {{#set: molecular weight=763.502 }} | + | {{#set: in pathway=}} |
− | {{#set: common name=CoA|co-A-SH|co-enzyme-A|co-A|HS-CoA}} | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: consumed by=RXN-2006|RXN66-483|RXN66-480|RXN-16561|RXN66-469|RXN66-484|RXN-16418|RXN-17116|RXN-1126|RXN0-7248|2.3.1.176-RXN|RXN-14268|RXN-2001|RXN-16389|ACYLCOASYN-RXN|RXN-17791|RXN3O-5304|RXN-11921|RXN-16380|LNLNCACOAL|RXN-10919|RXN-13617|ACETATE--COA-LIGASE-RXN|RXN3O-9780|RXN-10699|RXN-9673|BNorh|RXN-16401|RXN-8988|PYRUVDEH-RXN|RXN-15889|RXN-17795|RXN-13614|DHRT_2mbcoa|RXN-16137|2KETO-4METHYL-PENTANOATE-DEHYDROG-RXN|RXN-12978|DHRT_ibcoa|TRANS-RXN0-623|RXN-17799|RXN-17778|RXN-7904|RXN66-474|RXN-10695|RXN-14793|KETOACYLCOATHIOL-RXN|2.3.1.155-RXN|ACCAT|RXN-13290|RXN-11213|RXN66-477|RXN-14799|AKBLIG-RXN|RXN-12184|RXN-14774|RXN-17787|BNor|LNLCCOAL|LINOLENOYL-RXN|RXN0-7239|RXN-12710|RXN-14803|RXN-16393|HOLO-ACP-SYNTH-RXN|R223-RXN|RXN-2902|RXN-11917|RXN-17782|RXN-10700|RXN-10701|RXN-9644|RXN-11246|1.2.1.27-RXN|RXN0-7238|RXN-14394|RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.|RXN-14788|6.2.1.34-RXN|2-KETO-ADIPATE-DEHYDROG-RXN|RXN-9623|FACOAL18111Z|ENTDB-RXN|4-COUMARATE--COA-LIGASE-RXN|1.2.1.25-RXN|RXN-16402}} | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}} |
− | {{#set: produced by=DEPHOSPHOCOAKIN-RXN|IPMS|RXN-10821|3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN|RXN-12565|RXN-17729|FATTY-ACYL-COA-SYNTHASE-RXN|THIOESTER-RXN|RXN-16118|MALSYN-RXN|RXN-3142|RXN-15044|RXN-15045|RXN-15043|RXN0-6948|RXN-17855|RXN-17854|RXN-17857|RXN-17856|RXN-17851|RXN-17850|RXN-17853|RXN-17852|RXN-17859|RXN-17858|RXN-9629|FACOAE1839Z12Z15Z|RXN1G-445|RXN-16100|RXN-1106|RXN3DJ-118|RXN-1101|RXN1G-368|2.3.1.165-RXN|RXN-12547|RXN-9627|RXN-13322|RXN-9632|RXN-9624|2-ISOPROPYLMALATESYN-RXN|RXN-17021|RXN-17023|RXN-7697|DIHYDLIPACETRANS-RXN|RXN-15090|CITSYN-RXN|CSm|RXN-9648|RXN-6384|RXN-1623|CSx|RXN-13721|RXN-13435|RXN-13431|RXN-13430|RXN-16082|ACYL-COA-HYDROLASE-RXN|7KAPSYN-RXN|2.3.1.118-RXN|RXN-9652|RXN-9651|RXN-9650|RXN-17864|RXN-9654|RXN-17860|RXN-17861|RXN-17862|RXN-17863|RXN-9543|RXN-9653|ISOVALERYLCOA-DHLIPOAMIDE-RXN|DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN|RXN-16094|RXN-16098|ACACT7m|ACDHmi|ACACT|RXN-13297|RXN-13296|RXN-13295|RXN-13294|HICH|RXN-16017|RXN1G-499|RXN-9666|ARYLAMINE-N-ACETYLTRANSFERASE-RXN|RXN-10708|RXN0-1133|LINOLEOYL-RXN|SERINE-C-PALMITOYLTRANSFERASE-RXN|RXN-17011|RXN-17010|RXN-17019|MALONYL-COA-ACP-TRANSACYL-RXN|ACDHi|ADCPT|2.3.1.180-RXN|RXN-13446|RXN-13442|RXN-13441|RXN-7743|RXN-10059|RXN-17008|RXN-17009|RXN-16032|RXN-12362|RXN-12363|RXN-1381|GLUCOSAMINEPNACETYLTRANS-RXN|RXN-9192|SERINE-O-ACETTRAN-RXN|PALMITOYL-COA-HYDROLASE-RXN}} | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: consumed or produced by=RXN-16759|RXN1G-460|RXN-16063|RXN-1124|2.3.1.168-RXN|RXN-16066|TUBULIN-N-ACETYLTRANSFERASE-RXN|ACCOAtx|RXN-16103|RXN-10994|RXN-16415|HOMOSERINE-O-ACETYLTRANSFERASE-RXN|SUCCINATE--COA-LIGASE-GDP-FORMING-RXN|2.3.1.97-RXN|1.1.1.34-RXN|HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN|RXN-13671|RXN-12561|RXN-15036|RXN-13871|2KETO-3METHYLVALERATE-RXN|HISTONE-ACETYLTRANSFERASE-RXN|RXN-14274|RXN-14277|RXN0-1147|ACCOAth|RXN-8032|ACACT6|ACACT7|ACACT4|ACCOAtm|2.3.1.23-RXN|ACETYL-COA-ACETYLTRANSFER-RXN|RXN-13870|AKGDHe2r|RXN-13112|ALCOHOL-O-ACETYLTRANSFERASE-RXN|METHYLACETOACETYLCOATHIOL-RXN|N-ACETYLTRANSFER-RXN|ACP-S-ACETYLTRANSFER-RXN|SUCL_gdp_m|RXN-15066|LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN|SUCCCOASYN-RXN|ACETALD-DEHYDROG-RXN}} | + | |
Genes have been associated with this reaction based on different elements listed below.