Difference between revisions of "RXN-15121"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7770 PWY-7770] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7770 PWY-7770] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** indolmycin biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''10''' reactions in the full pathway |
− | == Reaction(s) | + | * [[SPONTPRO-RXN]] |
− | * [[ | + | ** 0 associated gene: |
− | == | + | ** 2 reconstruction source(s) associated: |
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10139 RXN-10139] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17529 RXN-17529] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17530 RXN-17530] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17531 RXN-17531] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17532 RXN-17532] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17533 RXN-17533] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17534 RXN-17534] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17535 RXN-17535] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17536 RXN-17536] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=indolmycin biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=10}} | |
− | + | {{#set: completion rate=10.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 19:09, 18 March 2018
Pathway PWY-7770
- taxonomic range:
- common name:
- indolmycin biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 10 reactions in the full pathway
- SPONTPRO-RXN
- 0 associated gene:
- 2 reconstruction source(s) associated: