Difference between revisions of "PWY-5706"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6389 PWY-6389] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6389 PWY-6389] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | * | + | |
* common name: | * common name: | ||
| − | ** | + | ** (S)-acetoin biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-acetoin biosynthesis |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''3''' reactions in the full pathway |
| − | * | + | * [[ACETOLACTSYN-RXN]] |
| − | * | + | ** 1 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_11362]] |
| − | + | ** 2 reconstruction source(s) associated: | |
| − | * [[ | + | *** [[manual-primary_network]] |
| − | * [[ | + | *** [[annotation-experimental_annotation]] |
| − | * [[ | + | * [[RXN-6081]] |
| − | * | + | ** 0 associated gene: |
| − | * [[ | + | ** 1 reconstruction source(s) associated: |
| − | == Reaction(s) | + | *** [[annotation-experimental_annotation]] |
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11032 RXN-11032] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=(S)-acetoin biosynthesis}} | |
| − | + | {{#set: common name=L-acetoin biosynthesis}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=67.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:10, 18 March 2018
Pathway PWY-6389
- taxonomic range:
- common name:
- (S)-acetoin biosynthesis
- Synonym(s):
- L-acetoin biosynthesis
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- ACETOLACTSYN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-6081
- 0 associated gene:
- 1 reconstruction source(s) associated:
