Difference between revisions of "TRIPEPTIDES"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2752 CPD-2752] == * smiles: ** C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6999 PWY-6999] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2752 CPD-2752] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6999 PWY-6999] ==
* smiles:
+
* taxonomic range:
** C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M
+
 
* common name:
 
* common name:
** trans-3-hydroxycotinine-glucuronide
+
** theophylline degradation
* molecular weight:
+
** 367.335   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''9''' reactions in the full pathway
* [[RXN66-162]]
+
* [[RXN0-901]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_11775]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[XANTHINE-OXIDASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_11775]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13108 RXN-13108]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13109 RXN-13109]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13110 RXN-13110]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13111 RXN-13111]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13113 RXN-13113]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13114 RXN-13114]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13115 RXN-13115]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820156 91820156]
+
{{#set: common name=theophylline degradation}}
* HMDB : HMDB01204
+
{{#set: reaction found=2}}
{{#set: smiles=C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))}}
+
{{#set: total reaction=9}}
{{#set: inchi key=InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M}}
+
{{#set: completion rate=22.0}}
{{#set: common name=trans-3-hydroxycotinine-glucuronide}}
+
{{#set: molecular weight=367.335    }}
+
{{#set: produced by=RXN66-162}}
+

Revision as of 18:10, 18 March 2018

Pathway PWY-6999

  • taxonomic range:
  • common name:
    • theophylline degradation
  • Synonym(s):

Reaction(s) found

2 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links