Difference between revisions of "RXN-6382"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1063 CPD-1063] == * smiles: ** CSCC(O)C(O)C(=O)COP([O-])(=O)[O-] * inchi key: ** InChIKey=C...") |
(Created page with "Category:Gene == Gene Tiso_gene_694 == * left end position: ** 27055 * transcription direction: ** POSITIVE * right end position: ** 29764 * centisome position: ** 90.7398...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_694 == |
− | * | + | * left end position: |
− | ** | + | ** 27055 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 29764 |
− | * | + | * centisome position: |
− | ** | + | ** 90.73987 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[ADENYL-KIN-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | * | + | ***ec-number |
− | == | + | == Pathways associated == |
+ | * [[PWY-7219]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=27055}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=29764}} | |
− | + | {{#set: centisome position=90.73987 }} | |
− | + | {{#set: reaction associated=ADENYL-KIN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7219}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:11, 18 March 2018
Gene Tiso_gene_694
- left end position:
- 27055
- transcription direction:
- POSITIVE
- right end position:
- 29764
- centisome position:
- 90.73987
- Synonym(s):
Reactions associated
- ADENYL-KIN-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation