Difference between revisions of "CPD-13758"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SSNOm SSNOm] == * direction: ** LEFT-TO-RIGHT * common name: ** succinate-semialdehyde:NAD+ oxidore...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-138 CPD1F-138] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SSNOm SSNOm] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-138 CPD1F-138] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))
 +
* inchi key:
 +
** InChIKey=ZCTUNYRXJKLWPY-LLCOKINKSA-M
 
* common name:
 
* common name:
−
** succinate-semialdehyde:NAD+ oxidoreductase, mitochondria
+
** gibberellin A12-aldehyde
 +
* molecular weight:
 +
** 315.431   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA12-aldehyde
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN1F-161]]
−
** 1.0 [[NAD]][m] '''+''' 1.0 [[SUCC-S-ALD]][m] '''+''' 1.0 [[WATER]][m] '''=>''' 1.0 [[NADH]][m] '''+''' 2.0 [[PROTON]][m] '''+''' 1.0 [[SUC]][m]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN1F-160]]
−
** 1.0 NAD+[m] '''+''' 1.0 succinate semialdehyde[m] '''+''' 1.0 H2O[m] '''=>''' 1.0 NADH[m] '''+''' 2.0 H+[m] '''+''' 1.0 succinate[m]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_6952]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=succinate-semialdehyde:NAD+ oxidoreductase, mitochondria}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244417 25244417]
−
{{#set: gene associated=Tiso_gene_6952}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57432 57432]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06093 C06093]
−
{{#set: reconstruction source=creinhardtii}}
+
* HMDB : HMDB39484
 +
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))}}
 +
{{#set: inchi key=InChIKey=ZCTUNYRXJKLWPY-LLCOKINKSA-M}}
 +
{{#set: common name=gibberellin A12-aldehyde}}
 +
{{#set: molecular weight=315.431    }}
 +
{{#set: common name=GA12-aldehyde}}
 +
{{#set: consumed by=RXN1F-161}}
 +
{{#set: produced by=RXN1F-160}}

Revision as of 15:51, 10 January 2018

Metabolite CPD1F-138

  • smiles:
    • C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))
  • inchi key:
    • InChIKey=ZCTUNYRXJKLWPY-LLCOKINKSA-M
  • common name:
    • gibberellin A12-aldehyde
  • molecular weight:
    • 315.431
  • Synonym(s):
    • GA12-aldehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-13758&oldid=10674"