Difference between revisions of "Tiso gene 3939"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=UDPNACETYLGALSYN-PWY UDPNACETYLGALSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAG...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=UDPNACETYLGALSYN-PWY UDPNACETYLGALSYN-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** UDP-N-acetyl-D-glucosamine biosynthesis II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** UDP-N-acetylgalactosamine biosynthesis |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''4''' reactions found over '''4''' reactions in the full pathway |
− | + | * [[GLUCOSAMINEPNACETYLTRANS-RXN]] | |
− | == Reaction(s) | + | ** 0 associated gene: |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_9051]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[NAG1P-URIDYLTRANS-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_6457]] | ||
+ | *** [[Tiso_gene_19372]] | ||
+ | *** [[Tiso_gene_6459]] | ||
+ | *** [[Tiso_gene_6458]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_13230]] | ||
+ | *** [[Tiso_gene_13231]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=UDP-N-acetyl-D-glucosamine biosynthesis II}} | |
− | {{#set: | + | {{#set: common name=UDP-N-acetylgalactosamine biosynthesis}} |
− | {{#set: | + | {{#set: reaction found=4}} |
− | {{#set: common name= | + | {{#set: total reaction=4}} |
− | {{#set: | + | {{#set: completion rate=100.0}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:12, 18 March 2018
Contents
Pathway UDPNACETYLGALSYN-PWY
- taxonomic range:
- common name:
- UDP-N-acetyl-D-glucosamine biosynthesis II
- Synonym(s):
- UDP-N-acetylgalactosamine biosynthesis
Reaction(s) found
4 reactions found over 4 reactions in the full pathway
- GLUCOSAMINEPNACETYLTRANS-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- L-GLN-FRUCT-6-P-AMINOTRANS-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- NAG1P-URIDYLTRANS-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- PHOSACETYLGLUCOSAMINEMUT-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated: