Difference between revisions of "OXALATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13936 CPD-13936] == * smiles: ** CC(=O)NC1(C(OC(CO)C(C(O)1)OC2(OC(CO)C(C(O)C(NC(=O)C)2)OC3(...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-820 RXN1G-820] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis,cis-delta1...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-820 RXN1G-820] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** trans-delta2-cis,cis-delta17,29-C48:3-[acyl-carrier protein] reductase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4] |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[3 | + | * With identifiers: |
| − | == | + | ** 1 [[trans-D2-cis-cis-D17-29-C48-3-ACPs]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[cis-cis-D17-29-C48-2-ACPs]][c] '''+''' 1 [[NAD]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 a trans-delta2-cis,cis-delta17,29-C48:3-[acp][c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 a cis,cis-delta17,29-C48:2-[acp][c] '''+''' 1 NAD+[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_10778]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
| + | ** '''86''' reactions found over '''182''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=trans-delta2-cis,cis-delta17,29-C48:3-[acyl-carrier protein] reductase}} | |
| − | {{#set: | + | {{#set: ec number=EC-1.3.1.M4}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_10778}} |
| − | {{#set: | + | {{#set: in pathway=PWYG-321}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-esiliculosus}} |
| + | {{#set: reconstruction tool=pantograph}} | ||
Revision as of 18:12, 18 March 2018
Contents
Reaction RXN1G-820
- direction:
- LEFT-TO-RIGHT
- common name:
- trans-delta2-cis,cis-delta17,29-C48:3-[acyl-carrier protein] reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 trans-D2-cis-cis-D17-29-C48-3-ACPs[c] + 1 NADH[c] + 1 PROTON[c] => 1 cis-cis-D17-29-C48-2-ACPs[c] + 1 NAD[c]
- With common name(s):
- 1 a trans-delta2-cis,cis-delta17,29-C48:3-[acp][c] + 1 NADH[c] + 1 H+[c] => 1 a cis,cis-delta17,29-C48:2-[acp][c] + 1 NAD+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
"trans-delta2-cis,cis-delta17,29-C48:3-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.
