Difference between revisions of "MG+2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O...")
(Created page with "Category:Gene == Gene Tiso_gene_17449 == * left end position: ** 150 * transcription direction: ** POSITIVE * right end position: ** 3594 * centisome position: ** 4.060639...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] ==
+
== Gene Tiso_gene_17449 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
+
** 150
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4α-methyl-5α-cholesta-8-en-3-one
+
** 3594
−
* molecular weight:
+
* centisome position:
−
** 398.671    
+
** 4.060639    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[ATPASE-RXN]]
−
* [[RXN66-18]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-12195]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-12196]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN0-5462]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=150}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263323 44263323]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3594}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87050 87050]
+
{{#set: centisome position=4.060639    }}
−
* HMDB : HMDB12174
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C}}
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
{{#set: inchi key=InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N}}
+
−
{{#set: common name=4α-methyl-5α-cholesta-8-en-3-one}}
+
−
{{#set: molecular weight=398.671    }}
+
−
{{#set: produced by=RXN66-18}}
+

Revision as of 18:13, 18 March 2018

Gene Tiso_gene_17449

  • left end position:
    • 150
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3594
  • centisome position:
    • 4.060639
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=MG%2B2&oldid=22737"