Difference between revisions of "Tiso gene 8618"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-cysteine-sulfinate N-terminal-L-cysteine-sulfinate] == * common name: ** an N-term...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] == * smiles: ** C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] == |
+ | * smiles: | ||
+ | ** C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=HUJXHFRXWWGYQH-UHFFFAOYSA-O | ||
* common name: | * common name: | ||
− | ** | + | ** O-sinapoylcholine |
+ | * molecular weight: | ||
+ | ** 310.369 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** sinapoylcholine | ||
+ | ** sinapine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.3.1.91-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 18696-26-9 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280385 5280385] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16353 16353] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00933 C00933] | ||
+ | * HMDB : HMDB29379 | ||
+ | {{#set: smiles=C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C}} | ||
+ | {{#set: inchi key=InChIKey=HUJXHFRXWWGYQH-UHFFFAOYSA-O}} | ||
+ | {{#set: common name=O-sinapoylcholine}} | ||
+ | {{#set: molecular weight=310.369 }} | ||
+ | {{#set: common name=sinapoylcholine|sinapine}} | ||
+ | {{#set: produced by=2.3.1.91-RXN}} |
Revision as of 18:13, 18 March 2018
Contents
Metabolite O-SINAPOYLCHOLINE
- smiles:
- C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C
- inchi key:
- InChIKey=HUJXHFRXWWGYQH-UHFFFAOYSA-O
- common name:
- O-sinapoylcholine
- molecular weight:
- 310.369
- Synonym(s):
- sinapoylcholine
- sinapine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C" cannot be used as a page name in this wiki.