Difference between revisions of "DHAP pi thr"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-4-aminobutylidene-eIF5A-lysine N-4-aminobutylidene-eIF5A-lysine] == * common name: ** an [eIF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == |
| + | * smiles: | ||
| + | ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) | ||
| + | * inchi key: | ||
| + | ** InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** 1D-myo-inositol 6-monophosphate |
| + | * molecular weight: | ||
| + | ** 258.121 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Ins(6)P1 |
| + | ** 1D-myo-inositol 6-phosphate | ||
| + | ** Ins(6)P | ||
| + | ** Ins6P | ||
| + | ** D-myo-inositol 6-monophosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10954]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203035 25203035] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64841 64841] |
| + | {{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)}} | ||
| + | {{#set: inchi key=InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L}} | ||
| + | {{#set: common name=1D-myo-inositol 6-monophosphate}} | ||
| + | {{#set: molecular weight=258.121 }} | ||
| + | {{#set: common name=Ins(6)P1|1D-myo-inositol 6-phosphate|Ins(6)P|Ins6P|D-myo-inositol 6-monophosphate}} | ||
| + | {{#set: consumed by=RXN-10954}} | ||
Revision as of 18:13, 18 March 2018
Contents
Metabolite CPD-6702
- smiles:
- C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
- inchi key:
- InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
- common name:
- 1D-myo-inositol 6-monophosphate
- molecular weight:
- 258.121
- Synonym(s):
- Ins(6)P1
- 1D-myo-inositol 6-phosphate
- Ins(6)P
- Ins6P
- D-myo-inositol 6-monophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.
