Difference between revisions of "CHLOROPHYLLIDE-A"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_9873 == * Synonym(s): == Reactions associated == * 1.14.11.2-RXN ** pantograph-esiliculosus * RXN490-3641 ** [[pantograph]...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] == * smiles: ** C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-] * inchi key: ** InChIKey=SQ...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_9873 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] ==
 +
* smiles:
 +
** C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-]
 +
* inchi key:
 +
** InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L
 +
* common name:
 +
** 3-(3'-methylthio)propylmalate
 +
* molecular weight:
 +
** 220.24   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-(3'-methylthio)propylmalic acid
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[1.14.11.2-RXN]]
+
* [[RXNQT-4165]]
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) known to produce the compound ==
* [[RXN490-3641]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-18208]]
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=1.14.11.2-RXN|RXN490-3641}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237292 44237292]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=133501 133501]
 +
{{#set: smiles=C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L}}
 +
{{#set: common name=3-(3'-methylthio)propylmalate}}
 +
{{#set: molecular weight=220.24    }}
 +
{{#set: common name=3-(3'-methylthio)propylmalic acid}}
 +
{{#set: consumed by=RXNQT-4165}}
 +
{{#set: reversible reaction associated=RXN-18208}}

Revision as of 18:14, 18 March 2018

Metabolite CPDQT-36

  • smiles:
    • C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-]
  • inchi key:
    • InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L
  • common name:
    • 3-(3'-methylthio)propylmalate
  • molecular weight:
    • 220.24
  • Synonym(s):
    • 3-(3'-methylthio)propylmalic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-" cannot be used as a page name in this wiki.