Difference between revisions of "Tiso gene 8689"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...")
(Created page with "Category:Gene == Gene Tiso_gene_3691 == * left end position: ** 7038 * transcription direction: ** NEGATIVE * right end position: ** 10040 * centisome position: ** 43.5546...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] ==
+
== Gene Tiso_gene_3691 ==
−
* smiles:
+
* left end position:
−
** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
+
** 7038
−
* inchi key:
+
* transcription direction:
−
** InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 1D-myo-inositol 6-monophosphate
+
** 10040
−
* molecular weight:
+
* centisome position:
−
** 258.121    
+
** 43.554676    
 
* Synonym(s):
 
* Synonym(s):
−
** Ins(6)P1
 
−
** 1D-myo-inositol 6-phosphate
 
−
** Ins(6)P
 
−
** Ins6P
 
−
** D-myo-inositol 6-monophosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10954]]
+
* [[FUMHYDR-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 +
* [[FERMENTATION-PWY]]
 +
* [[PWY-561]]
 +
* [[PWY-5913]]
 +
* [[P42-PWY]]
 +
* [[PWY-7384]]
 +
* [[PWY-5392]]
 +
* [[P23-PWY]]
 +
* [[P105-PWY]]
 +
* [[PWY-6969]]
 +
* [[PWY-6728]]
 +
* [[REDCITCYC]]
 +
* [[PWY-7254]]
 +
* [[P108-PWY]]
 +
* [[PWY-5690]]
 +
* [[PWY66-398]]
 +
* [[TCA]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=7038}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203035 25203035]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=10040}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64841 64841]
+
{{#set: centisome position=43.554676    }}
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)}}
+
{{#set: reaction associated=FUMHYDR-RXN}}
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L}}
+
{{#set: pathway associated=FERMENTATION-PWY|PWY-561|PWY-5913|P42-PWY|PWY-7384|PWY-5392|P23-PWY|P105-PWY|PWY-6969|PWY-6728|REDCITCYC|PWY-7254|P108-PWY|PWY-5690|PWY66-398|TCA}}
−
{{#set: common name=1D-myo-inositol 6-monophosphate}}
+
−
{{#set: molecular weight=258.121    }}
+
−
{{#set: common name=Ins(6)P1|1D-myo-inositol 6-phosphate|Ins(6)P|Ins6P|D-myo-inositol 6-monophosphate}}
+
−
{{#set: consumed by=RXN-10954}}
+

Revision as of 18:14, 18 March 2018

Gene Tiso_gene_3691

  • left end position:
    • 7038
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 10040
  • centisome position:
    • 43.554676
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8689&oldid=22852"